•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Reference Compounds

Set Ascending Direction

   

Items 41 to 50 of 7281 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7
  1. CID-2858522

    CAS No.: 758679-97-9
    Catalog No.: 100844
    Purity: 95%
    MF: C28H39N3O3
    MW: 465.638
    Storage: 2-8 degree Celsius
  2. Cobimetinib; GDC-0973; RG7420

    CAS No.: 934660-93-2
    Catalog No.: 100636
    Purity: 95%
    MF: C21H21F3IN3O2
    MW: 531.316
    Storage: 2-8 degree Celsius
    SMILES: OC1(CN(C1)C(=O)C1=CC=C(F)C(F)=C1NC1=CC=C(I)C=C1F)[C@@H]1CCCCN1
  3. Crizotinib; PF-02341066

    CAS No.: 877399-52-5
    Catalog No.: 100966
    Purity: 95%
    MF: C21H22Cl2FN5O
    MW: 450.345
    Storage: 2-8 degree Celsius
    SMILES: C[C@@H](OC1=CC(=CN=C1N)C1=CN(N=C1)C1CCNCC1)C1=C(Cl)C=CC(F)=C1Cl
  4. Enzalutamide; MDV3100; MDV 3100

    CAS No.: 915087-33-1
    Catalog No.: 101095
    Purity: 95%
    MF: C21H16F4N4O2S
    MW: 464.444
    Storage: 2-8 degree Celsius
    SMILES: CNC(=O)C1=CC=C(C=C1F)N1C(=S)N(C(=O)C1(C)C)C1=CC=C(C#N)C(=C1)C(F)(F)F
  5. Erlotinib HCl; CP-358774; OSI-774; NSC 718781

    CAS No.: 183319-69-9
    Catalog No.: 101009
    Purity: 95%
    MF: C22H24ClN3O4
    MW: 429.904
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].COCCOC1=CC2=NC=NC(NC3=CC=CC(=C3)C#C)=C2C=C1OCCOC
  6. Fingolimod (FTY720) HCl

    CAS No.: 162359-56-0
    Catalog No.: 100581
    Purity: 95%
    MF: C19H34ClNO2
    MW: 343.939
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].CCCCCCCCC1=CC=C(CCC(N)(CO)CO)C=C1
  7. GW441756; GW 441756

    CAS No.: 504433-23-2
    Catalog No.: 100878
    Purity: 95%
    MF: C17H13N3O
    MW: 275.311
    Storage: 2-8 degree Celsius
    SMILES: CN1C=C(\C=C2/C(=O)NC3=CC=CN=C23)C2=C1C=CC=C2
  8. Kartogenin; KGN

    CAS No.: 4727-31-5
    Catalog No.: 100822
    Purity: 95%
    MF: C20H15NO3
    MW: 317.344
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1=CC=CC=C1C(=O)NC1=CC=C(C=C1)C1=CC=CC=C1
  9. kb NB 142-70; kb-NB142-70

    CAS No.: 1233533-04-4
    Catalog No.: 100774
    Purity: 95%
    MF: C11H9NO2S2
    MW: 251.332
    Storage: 2-8 degree Celsius
  10. KY02111; KY 02111

    CAS No.: 1118807-13-8
    Catalog No.: 100786
    Purity: 95%
    MF: C18H17ClN2O3S
    MW: 376.865
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=C(CCC(=O)NC2=NC3=CC=C(Cl)C=C3S2)C=C1OC
Loading ...Load More ...
Set Ascending Direction

   

Items 41 to 50 of 7281 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7