•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Raf

Set Ascending Direction

   

Items 1 to 10 of 31 total

  1. 1
  2. 2
  3. 3
  4. 4
  1. LY-3009120

    CAS No.: 1454682-72-4
    Catalog No.: 140522
    Purity: 95%
    MF: C23H29FN6O
    MW: 424.524
    Storage: 2-8 degree Celsius
    SMILES: CNC1=NC=C2C=C(C(C)=NC2=N1)C1=CC(NC(=O)NCCC(C)(C)C)=C(F)C=C1C
  2. LUT-014

    CAS No.: 2274819-46-2
    Catalog No.: ZB1544
    Purity: 95%
    MF: C27H19F3N8O
    MW: 528.498
    Storage: 2-8 degree Celsius
    SMILES: N1=CN=C2NC=NC2=C1C=1C(=NC=CC1)NC=1C=2C=CN=C(C2C=CC1C)NC1=CC(=CC=C1)OC(F)(F)F
  3. AD80

    CAS No.: 1384071-99-1
    Catalog No.: ZB1526
    Purity: 95%
    MF: C22H19F4N7O
    MW: 473.434
    Storage: 2-8 degree Celsius
    SMILES: NC1=C2C(=NC=N1)N(N=C2C2=CC=C(C=C2)NC(=O)NC2=C(C=CC(=C2)C(F)(F)F)F)C(C)C
  4. AZ304

    CAS No.: 942507-42-8
    Catalog No.: ZB1523
    Purity: 95%
    MF: C27H25N5O2
    MW: 451.53
    Storage: 2-8 degree Celsius
    SMILES: C(#N)C(C)(C)C=1C=C(C(=O)NC2=CC(=C(C=C2)C)NC2=NC=NC3=CC(=CC=C23)OC)C=CC1
  5. Belvarafenib

    CAS No.: 1446113-23-0
    Catalog No.: WLZ0044
    Purity: 95%
    MF: C23H16ClFN6OS
    MW: 478.94
    Storage: 2-8 degree Celsius
    SMILES: NC=1C2=C(N=CN1)C(=CS2)C(=O)NC2=C1C=CN=C(C1=CC=C2C)NC2=C(C(=CC=C2)Cl)F
  6. B-Raf inhibitor 1 dihydrochloride

    CAS No.: 1191385-19-9
    Catalog No.: 186473
    Purity: 95%
    MF: C26H21Cl3N8
    MW: 551.869
    Storage: 2-8 degree Celsius
    SMILES: Cl.Cl.N1=CN=C2NC=NC2=C1C=1C(=NC=CC1)NC=1C=2C=CN=C(C2C=CC1C)NC1=CC=C(C=C1)Cl
  7. LXH254

    CAS No.: 1800398-38-2
    Catalog No.: 186422
    Purity: 95%
    MF: C25H25F3N4O4
    MW: 502.493
    Storage: 2-8 degree Celsius
    SMILES: OCCOC1=NC(=CC(=C1)C=1C=C(C=CC1C)NC(C1=CC(=NC=C1)C(F)(F)F)=O)N1CCOCC1
  8. RAF709

    CAS No.: 1628838-42-5
    Catalog No.: 186309
    Purity: 95%
    MF: C28H29F3N4O4
    MW: 542.558
    Storage: 2-8 degree Celsius
    SMILES: CC1=NC=C(C=C1C=1C=NC(=C(C1)N1CCOCC1)OC1CCOCC1)NC(C1=CC(=CC=C1)C(F)(F)F)=O
  9. L-779450

    CAS No.: 303727-31-3
    Catalog No.: 157246
    Purity: 95%
    MF: C20H14ClN3O
    MW: 347.805
    Storage: 2-8 degree Celsius
    SMILES: OC1=C(Cl)C=CC(=C1)C1=C(N=C(N1)C1=CC=CC=C1)C1=CC=NC=C1
  10. B-Raf IN 1

    CAS No.: 950736-05-7
    Catalog No.: 153182
    Purity: 95%
    MF: C29H24F3N5O
    MW: 515.539
    Storage: 2-8 degree Celsius
    SMILES: CN(C)CC1=CC=C(C=C1)C1=C2N=CC=C(N2N=C1)C1=CC=CC(NC(=O)C2=CC(=CC=C2)C(F)(F)F)=C1
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 31 total

  1. 1
  2. 2
  3. 3
  4. 4