•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

RAAS

Set Descending Direction

   

Items 1 to 10 of 26 total

  1. 1
  2. 2
  3. 3
  1. Perindopril Erbumine

    CAS No.: 107133-36-8
    Catalog No.: 141404
    Purity: 95%
    MF: C23H43N3O5
    MW: 441.613
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)N.[H][C@]12C[C@H](N(C(=O)[C@H](C)N[C@@H](CCC)C(=O)OCC)[C@@]1([H])CCCC2)C(O)=O
  2. PD-123319 TFA salt

    CAS No.: 136676-91-0
    Catalog No.: 171829
    Purity: 95%
    MF: C35H34F6N4O7
    MW: 736.666
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C(F)(F)F.OC(=O)C(F)(F)F.CN(C)C1=C(C)C=C(CN2C=NC3=C2C[C@H](N(C3)C(=O)C(C2=CC=CC=C2)C2=CC=CC=C2)C(O)=O)C=C1
  3. VX-150

    CAS No.: 1793080-72-4
    Catalog No.: 195282
    Purity: 95%
    MF: C21H17F4N2O7P
    MW: 516.34
    Storage: 2-8 degree Celsius
    SMILES: P(=O)(OCN1C(C=C(C=C1)NC(C1=C(C=C(C=C1)C(F)(F)F)OC1=C(C=C(C=C1)F)C)=O)=O)(O)O
  4. Quinapril HCl

    CAS No.: 82586-55-8
    Catalog No.: 151738
    Purity: 95%
    MF: C25H31ClN2O5
    MW: 474.985
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].CCOC(=O)[C@H](CCC1=CC=CC=C1)N[C@@H](C)C(=O)N1CC2=C(C[C@H]1C(O)=O)C=CC=C2
  5. Aliskiren Hemifumarate

    CAS No.: 173334-58-2
    Catalog No.: 151600
    Purity: 95%
    MF: C34H57N3O10
    MW: 667.841
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)\C=C\C(O)=O.COCCCOC1=CC(C[C@@H](C[C@H](N)[C@@H](O)C[C@@H](C(C)C)C(=O)NCC(C)(C)C(N)=O)C(C)C)=CC=C1OC
  6. Temocapril HCl

    CAS No.: 110221-44-8
    Catalog No.: 151584
    Purity: 95%
    MF: C23H29ClN2O5S2
    MW: 513.081
    Storage: 2-8 degree Celsius
    SMILES: Cl.CCOC(=O)[C@H](CCC1=CC=CC=C1)N[C@H]1CS[C@@H](CN(CC(O)=O)C1=O)C1=CC=CS1
  7. Temocapril

    CAS No.: 111902-57-9
    Catalog No.: 151585
    Purity: 95%
    MF: C23H28N2O5S2
    MW: 476.62
    Storage: 2-8 degree Celsius
    SMILES: CCOC(=O)[C@H](CCC1=CC=CC=C1)N[C@H]1CS[C@@H](CN(CC(O)=O)C1=O)C1=CC=CS1
  8. Ramipril

    CAS No.: 87333-19-5
    Catalog No.: 151508
    Purity: 95%
    MF: C23H32N2O5
    MW: 416.518
    Storage: 2-8 degree Celsius
    SMILES: [H][C@@]12CCC[C@]1([H])N([C@@H](C2)C(O)=O)C(=O)[C@H](C)N[C@@H](CCC1=CC=CC=C1)C(=O)OCC
  9. Moexipril HCl

    CAS No.: 82586-52-5
    Catalog No.: 151577
    Purity: 95%
    MF: C27H35ClN2O7
    MW: 535.037
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].CCOC(=O)[C@H](CCC1=CC=CC=C1)N[C@@H](C)C(=O)N1CC2=C(C[C@H]1C(O)=O)C=C(OC)C(OC)=C2
  10. Lisinopril

    CAS No.: 83915-83-7
    Catalog No.: 151576
    Purity: 95%
    MF: C21H35N3O7
    MW: 441.525
    Storage: 2-8 degree Celsius
    SMILES: [H]O[H].[H]O[H].NCCCC[C@H](N[C@@H](CCC1=CC=CC=C1)C(O)=O)C(=O)N1CCC[C@H]1C(O)=O
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 26 total

  1. 1
  2. 2
  3. 3