•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Quinoxalines

Set Descending Direction

   

Items 1 to 10 of 211 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. quinoxaline-6-carboxylic acid

    CAS No.: 6925-00-4
    Catalog No.: 100724
    Purity: 95%
    MF: C9H6N2O2
    MW: 174.159
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1=CC=C2N=CC=NC2=C1
  2. quinoxaline-6-carbonyl chloride

    CAS No.: 258503-93-4
    Catalog No.: 100725
    Purity: 95%
    MF: C9H5ClN2O
    MW: 192.605
    Storage: 2-8 degree Celsius
    SMILES: ClC(=O)C1=CC=C2N=CC=NC2=C1
  3. 2-chloroquinoxaline

    CAS No.: 1448-87-9
    Catalog No.: 102324
    Purity: 95%
    MF: C8H5ClN2
    MW: 164.595
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC2=CC=CC=C2N=C1
  4. 7-fluoro-3-oxo-3,4-dihydroquinoxaline-2-carboxylic acid

    CAS No.: 885271-79-4
    Catalog No.: 102587
    Purity: 95%
    MF: C9H5FN2O3
    MW: 208.148
    Storage: 2-8 degree Celsius
  5. 7-bromo-2-chloroquinoxaline

    CAS No.: 89891-65-6
    Catalog No.: 103338
    Purity: 95%
    MF: C8H4BrClN2
    MW: 243.491
    Storage: 2-8 degree Celsius
  6. quinoxaline-2-carbaldehyde

    CAS No.: 1593-08-4
    Catalog No.: 104698
    Purity: 95%
    MF: C9H6N2O
    MW: 158.16
    Storage: 2-8 degree Celsius
    SMILES: O=CC1=NC2=CC=CC=C2N=C1
  7. 9-methylpyrido[2,3-f]quinoxaline

    CAS No.: 1351516-05-6
    Catalog No.: 104731
    Purity: 95%
    MF: C12H9N3
    MW: 195.225
    Storage: 2-8 degree Celsius
  8. pyrido[2,3-f]quinoxaline-9-carbaldehyde

    CAS No.: 1351516-06-7
    Catalog No.: 104732
    Purity: 95%
    MF: C12H7N3O
    MW: 209.208
    Storage: 2-8 degree Celsius
  9. 3-methylquinoxalin-2(1H)-one

    CAS No.: 14003-34-0
    Catalog No.: 104735
    Purity: 95%
    MF: C9H8N2O
    MW: 160.176
    Storage: 2-8 degree Celsius
    SMILES: CC1=NC2=C(NC1=O)C=CC=C2
  10. 2-methoxy-3-methylquinoxaline

    CAS No.: 3149-26-6
    Catalog No.: 104736
    Purity: 95%
    MF: C10H10N2O
    MW: 174.203
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 211 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5