•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Quinolines

Set Ascending Direction

   

Items 41 to 50 of 1209 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7
  1. 4-(3-((2,4-dichloro-6-methoxyquinolin-7-yl)oxy)propyl)morpholine

    CAS No.: 1846569-15-0
    Catalog No.: TQR0464
    Purity: 95%
    MF: C17H20Cl2N2O3
    MW: 371.264
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC2=CC(=C(C=C2C(=C1)Cl)OC)OCCCN1CCOCC1
  2. 7-(benzyloxy)-2,4-dichloro-6-methoxyquinoline

    CAS No.: 1846572-62-0
    Catalog No.: TQR0470
    Purity: 95%
    MF: C17H13Cl2NO2
    MW: 334.202
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)OC1=C(C=C2C(=CC(=NC2=C1)Cl)Cl)OC
  3. 4-(2-fluoro-4-nitrophenoxy)-6-methoxyquinolin-7-ol

    CAS No.: 479690-08-9
    Catalog No.: TQR0531
    Purity: 95%
    MF: C16H11FN2O5
    MW: 330.271
    Storage: 2-8 degree Celsius
    SMILES: FC1=C(OC2=CC=NC3=CC(=C(C=C23)OC)O)C=CC(=C1)[N+](=O)[O-]
  4. methyl 2-(4-bromophenyl)quinoline-4-carboxylate

    CAS No.: 350997-62-5
    Catalog No.: TQR0578
    Purity: 95%
    MF: C17H12BrNO2
    MW: 342.192
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=C(C=C1)C1=NC2=CC=CC=C2C(=C1)C(=O)OC
  5. ethyl 2-(4-bromophenyl)quinoline-4-carboxylate

    CAS No.: 351982-02-0
    Catalog No.: TQR0579
    Purity: 95%
    MF: C18H14BrNO2
    MW: 356.219
    Storage: 2-8 degree Celsius
    SMILES: O=C(C1=CC(C2=CC=C(Br)C=C2)=NC3=CC=CC=C13)OCC
  6. 2-(4-bromophenyl)-6-fluoro-3-methylquinoline-4-carboxylic acid

    CAS No.: 130507-37-8
    Catalog No.: TQR0580
    Purity: 95%
    MF: C17H11BrFNO2
    MW: 360.182
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=C(C=C1)C1=NC2=CC=C(C=C2C(=C1C)C(=O)O)F
  7. 2-(4-bromophenyl)-3-methylquinoline-4-carboxylic acid

    CAS No.: 723252-42-4
    Catalog No.: TQR0581
    Purity: 95%
    MF: C17H12BrNO2
    MW: 342.192
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=C(C=C1)C1=NC2=CC=CC=C2C(=C1C)C(=O)O
  8. methyl 2-(4-bromophenyl)-6-fluoro-3-methylquinoline-4-carboxylate

    CAS No.: 2138328-39-7
    Catalog No.: TQR0582
    Purity: 95%
    MF: C18H13BrFNO2
    MW: 374.209
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=C(C=C1)C1=NC2=CC=C(C=C2C(=C1C)C(=O)OC)F
  9. 2-(4-bromophenyl)-3,6-dimethylquinoline-4-carboxylic acid

    CAS No.: 438215-90-8
    Catalog No.: TQR0583
    Purity: 95%
    MF: C18H14BrNO2
    MW: 356.219
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=C(C=C1)C1=NC2=CC=C(C=C2C(=C1C)C(=O)O)C
  10. 2-(4-bromophenyl)-6-chloro-3-methylquinoline-4-carboxylic acid

    CAS No.: 2220250-14-4
    Catalog No.: TQR0584
    Purity: 95%
    MF: C17H11BrClNO2
    MW: 376.637
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=C(C=C1)C1=NC2=CC=C(C=C2C(=C1C)C(=O)O)Cl
Loading ...Load More ...
Set Ascending Direction

   

Items 41 to 50 of 1209 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7