•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Quinolines

Set Ascending Direction

   

Items 21 to 30 of 2470 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 4-bromo-3-(trifluoromethyl)quinoline

    CAS No.: 590371-97-4
    Catalog No.: 101958
    Purity: 95%
    MF: C10H5BrF3N
    MW: 276.055
    Storage: 2-8 degree Celsius
    SMILES: FC(F)(F)C1=C(Br)C2=CC=CC=C2N=C1
  2. 4-chloro-3-(trifluoromethyl)quinoline

    CAS No.: 590371-93-0
    Catalog No.: 101959
    Purity: 95%
    MF: C10H5ClF3N
    MW: 231.604
    Storage: 2-8 degree Celsius
    SMILES: FC(F)(F)C1=C(Cl)C2=CC=CC=C2N=C1
  3. 2-aminoquinoline-5-carboxylic acid

    CAS No.: 496806-75-8
    Catalog No.: 102045
    Purity: 95%
    MF: C10H8N2O2
    MW: 188.186
    Storage: 2-8 degree Celsius
    SMILES: NC1=NC2=CC=CC(C(O)=O)=C2C=C1
  4. 2-chloro-5-quinolinecarboxylic acid methyl ester

    CAS No.: 1192569-38-2
    Catalog No.: 102046
    Purity: 95%
    MF: C11H8ClNO2
    MW: 221.643
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)C1=C2C=CC(Cl)=NC2=CC=C1
  5. 6-methoxyquinolin-4(1H)-one

    CAS No.: 13788-72-2
    Catalog No.: 102107
    Purity: 95%
    MF: C10H9NO2
    MW: 175.187
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC2=C(NC=CC2=O)C=C1
  6. 4-bromo-6-methoxyquinoline

    CAS No.: 42881-66-3
    Catalog No.: 102108
    Purity: 95%
    MF: C10H8BrNO
    MW: 238.084
    Storage: 2-8 degree Celsius
  7. 4-bromo-6-methoxyquinoline-3-carboxylic acid

    CAS No.: 872714-51-7
    Catalog No.: 102114
    Purity: 95%
    MF: C11H8BrNO3
    MW: 282.093
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=C2N=CC(C(O)=O)=C(Br)C2=C1
  8. Ethyl 4-bromo-6-methoxyquinoline-3-carboxylate

    CAS No.: 872714-50-6
    Catalog No.: 102115
    Purity: 95%
    MF: C13H12BrNO3
    MW: 310.147
    Storage: 2-8 degree Celsius
    SMILES: CCOC(=O)C1=C(Br)C2=CC(OC)=CC=C2N=C1
  9. 4-bromo-3-chloro-6-methoxyquinoline

    CAS No.: 426842-71-9
    Catalog No.: 102119
    Purity: 95%
    MF: C10H7BrClNO
    MW: 272.529
    Storage: 2-8 degree Celsius
  10. 6-methoxyquinolin-4-ol

    CAS No.: 23432-39-5
    Catalog No.: 102120
    Purity: 95%
    MF: C10H9NO2
    MW: 175.187
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=C2N=CC=C(O)C2=C1
Loading ...Load More ...
Set Ascending Direction

   

Items 21 to 30 of 2470 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5