•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Quinolines

Set Ascending Direction

   

Items 11 to 20 of 2470 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 1,4-dimethylquinolin-2(1H)-one

    CAS No.: 2584-47-6
    Catalog No.: 101457
    Purity: 95%
    MF: C11H11NO
    MW: 173.215
    Storage: 2-8 degree Celsius
  2. 7-methoxy-2,2,4-trimethyl-1,2-dihydroquinoline

    CAS No.: 1810-74-8
    Catalog No.: 101478
    Purity: 95%
    MF: C13H17NO
    MW: 203.285
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC2=C(C=C1)C(C)=CC(C)(C)N2
  3. 2-bromo-4-(trifluoromethyl)quinoline

    CAS No.: 590372-17-1
    Catalog No.: 101911
    Purity: 95%
    MF: C10H5BrF3N
    MW: 276.055
    Storage: 2-8 degree Celsius
    SMILES: FC(F)(F)C1=CC(Br)=NC2=CC=CC=C12
  4. 2-chloro-3-(trifluoromethyl)quinoline

    CAS No.: 25199-86-4
    Catalog No.: 101914
    Purity: 95%
    MF: C10H5ClF3N
    MW: 231.604
    Storage: 2-8 degree Celsius
    SMILES: FC(F)(F)C1=CC2=CC=CC=C2N=C1Cl
  5. 2-chloro-4-(trifluoromethyl)quinoline

    CAS No.: 2806-29-3
    Catalog No.: 101916
    Purity: 95%
    MF: C10H5ClF3N
    MW: 231.604
    Storage: 2-8 degree Celsius
    SMILES: FC(F)(F)C1=CC(Cl)=NC2=CC=CC=C12
  6. 2-(trifluoromethyl)quinoline-4-carboxylic acid

    CAS No.: 18706-39-3
    Catalog No.: 101927
    Purity: 95%
    MF: C11H6F3NO2
    MW: 241.168
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1=CC(=NC2=CC=CC=C12)C(F)(F)F
  7. 3-(trifluoromethyl)quinoline-4-carboxylic acid

    CAS No.: 588702-65-2
    Catalog No.: 101948
    Purity: 95%
    MF: C11H6F3NO2
    MW: 241.168
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1=C(C=NC2=CC=CC=C12)C(F)(F)F
  8. 4-chloro-3-iodoquinoline

    CAS No.: 590371-90-7
    Catalog No.: 101949
    Purity: 95%
    MF: C9H5ClIN
    MW: 289.503
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(I)C=NC2=CC=CC=C12
  9. 4-(trifluoromethyl)quinolin-2-ol

    CAS No.: 25199-84-2
    Catalog No.: 101953
    Purity: 95%
    MF: C10H6F3NO
    MW: 213.158
    Storage: 2-8 degree Celsius
    SMILES: OC1=NC2=CC=CC=C2C(=C1)C(F)(F)F
  10. 4-bromo-2-(trifluoromethyl)quinoline

    CAS No.: 18706-25-7
    Catalog No.: 101957
    Purity: 95%
    MF: C10H5BrF3N
    MW: 276.055
    Storage: 2-8 degree Celsius
    SMILES: FC(F)(F)C1=NC2=CC=CC=C2C(Br)=C1
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 2470 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5