•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Quinazolines

Set Descending Direction

   

Items 1 to 10 of 648 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 6-bromo-4-chloroquinazoline

    CAS No.: 38267-96-8
    Catalog No.: 100226
    Purity: 95%
    MF: C8H4BrClN2
    MW: 243.491
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C2C=C(Br)C=CC2=NC=N1
  2. 2,4-dichloro-6-methoxyquinazoline

    CAS No.: 105763-77-7
    Catalog No.: 100366
    Purity: 95%
    MF: C9H6Cl2N2O
    MW: 229.066
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC2=C(Cl)N=C(Cl)N=C2C=C1
  3. 6-methoxyquinazoline-2,4(1H,3H)-dione

    CAS No.: 32618-84-1
    Catalog No.: 100367
    Purity: 95%
    MF: C9H8N2O3
    MW: 192.174
    Storage: 2-8 degree Celsius
  4. 2,4-dichloro-7-methoxyquinazoline

    CAS No.: 62484-31-5
    Catalog No.: 100368
    Purity: 95%
    MF: C9H6Cl2N2O
    MW: 229.066
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC2=NC(Cl)=NC(Cl)=C2C=C1
  5. 7-methoxyquinazoline-2,4(1H,3H)-dione

    CAS No.: 62484-12-2
    Catalog No.: 100369
    Purity: 95%
    MF: C9H8N2O3
    MW: 192.174
    Storage: 2-8 degree Celsius
  6. 6,7-dimethoxyquinazolin-4(3H)-one

    CAS No.: 13794-72-4
    Catalog No.: 100732
    Purity: 95%
    MF: C10H10N2O3
    MW: 206.201
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC2=C(C=C1OC)C(=O)NC=N2
  7. 4-(3-bromophenylamino)quinazoline-6,7-diol

    CAS No.: 169205-86-1
    Catalog No.: 100734
    Purity: 95%
    MF: C14H10BrN3O2
    MW: 332.157
    Storage: 2-8 degree Celsius
  8. 2-(chloromethyl)-4-methylquinazoline

    CAS No.: 109113-72-6
    Catalog No.: 100884
    Purity: 95%
    MF: C10H9ClN2
    MW: 192.649
    Storage: 2-8 degree Celsius
    SMILES: CC1=C2C=CC=CC2=NC(CCl)=N1
  9. 5-bromoquinazolin-2-amine

    CAS No.: 181871-83-0
    Catalog No.: 100900
    Purity: 95%
    MF: C8H6BrN3
    MW: 224.061
    Storage: 2-8 degree Celsius
  10. 4,7-dichloro-6-nitroquinazoline

    CAS No.: 162012-71-7
    Catalog No.: 100954
    Purity: 95%
    MF: C8H3Cl2N3O2
    MW: 244.037
    Storage: 2-8 degree Celsius
    SMILES: [O-][N+](=O)C1=CC2=C(Cl)N=CN=C2C=C1Cl
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 648 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5