•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyrrolotriazines

Set Ascending Direction

   

Items 11 to 20 of 52 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 7-bromo-4-chloropyrrolo[2,1-f][1,2,4]triazine

    CAS No.: 1269667-51-7
    Catalog No.: 171230
    Purity: 95%
    MF: C6H3BrClN3
    MW: 232.468
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=NN2C(Br)=CC=C12
  2. 7-bromo-2-chloropyrrolo[2,1-f][1,2,4]triazine

    CAS No.: 1233186-50-9
    Catalog No.: 171381
    Purity: 95%
    MF: C6H3BrClN3
    MW: 232.468
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NN2C(Br)=CC=C2C=N1
  3. 5-bromo-2-(methylthio)pyrrolo[2,1-f][1,2,4]triazine

    CAS No.: 1233181-67-3
    Catalog No.: 171382
    Purity: 95%
    MF: C7H6BrN3S
    MW: 244.117
    Storage: 2-8 degree Celsius
    SMILES: CSC1=NN2C=CC(Br)=C2C=N1
  4. ethyl 4-chloro-5-(propan-2-yl)pyrrolo[2,1-f][1,2,4]triazine-6-carboxylate

    CAS No.: 658084-80-1
    Catalog No.: 170116
    Purity: 95%
    MF: C12H14ClN3O2
    MW: 267.716
    Storage: 2-8 degree Celsius
    SMILES: CCOC(=O)C1=CN2N=CN=C(Cl)C2=C1C(C)C
  5. 6-bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine

    CAS No.: 1160995-23-2
    Catalog No.: 171568
    Purity: 95%
    MF: C6H2BrCl2N3
    MW: 266.913
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NN2C=C(Br)C=C2C(Cl)=N1
  6. 4-chloro-2-(methylsulfanyl)pyrrolo[2,1-f][1,2,4]triazine

    CAS No.: 1120214-78-9
    Catalog No.: 171629
    Purity: 95%
    MF: C7H6ClN3S
    MW: 199.666
    Storage: 2-8 degree Celsius
    SMILES: CSC1=NN2C=CC=C2C(Cl)=N1
  7. 7-bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine

    CAS No.: 1008112-03-5
    Catalog No.: 171778
    Purity: 95%
    MF: C6H2BrCl2N3
    MW: 266.913
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NN2C(Br)=CC=C2C(Cl)=N1
  8. (S)-2-(1-aminoethyl)-5-methyl-3-phenylpyrrolo[2,1-f][1,2,4]triazin-4(3H)-one

    CAS No.: 1403943-08-7
    Catalog No.: TQR0325
    Purity: 95%
    MF: C15H16N4O
    MW: 268.32
    Storage: 2-8 degree Celsius
    SMILES: N[C@@H](C)C1=NN2C(C(N1C1=CC=CC=C1)=O)=C(C=C2)C
  9. 7-iodopyrrolo[2,1-f][1,2,4]triazin-4-amine

    CAS No.: 1770840-43-1
    Catalog No.: ZB1792
    Purity: 95%
    MF: C6H5IN4
    MW: 260.038
    Storage: 2-8 degree Celsius
    SMILES: IC1=CC=C2C(=NC=NN21)N
  10. 4-chloropyrrolo[2,1-f][1,2,4]triazine

    CAS No.: 888720-29-4
    Catalog No.: 142298
    Purity: 95%
    MF: C6H4ClN3
    MW: 153.572
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=NN2C=CC=C12
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 52 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5