•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyrroloquinolines

Set Descending Direction

   

Items 1 to 10 of 21 total

  1. 1
  2. 2
  3. 3
  1. 8-(2-chloroacetyl)-5,6-dihydro-1H-pyrrolo[3,2,1-ij]quinolin-4(2H)-one

    CAS No.: 1005743-89-4
    Catalog No.: TQR0282
    Purity: 95%
    MF: C13H12ClNO2
    MW: 249.697
    Storage: 2-8 degree Celsius
    SMILES: ClCC(=O)C=1C=C2CCC(N3C2=C(C1)CC3)=O
  2. 6,8-diamino-7-chloro-1-methyl-2-oxo-1,2-dihydropyrrolo[4,3,2-de]quinoline-4-carboxamide

    CAS No.: 1096365-01-3
    Catalog No.: 186967
    Purity: 95%
    MF: C12H10ClN5O2
    MW: 291.698
    Storage: 2-8 degree Celsius
    SMILES: NC1=C(C(=C2C3=C(C=C(N=C13)C(=O)N)C(N2C)=O)N)Cl
  3. 1H,2H,3H,3aH,4H,5H,9bH-pyrrolo[3,4-c]quinolin-4-one

    CAS No.: 1017782-20-5
    Catalog No.: 156498
    Purity: 95%
    MF: C11H12N2O
    MW: 188.23
    Storage: 2-8 degree Celsius
    SMILES: O=C1NC2=C(C=CC=C2)C2CNCC12
  4. 1H-pyrrolo[3,2-h]quinoline-2-carboxylic acid

    CAS No.: 58457-37-7
    Catalog No.: 155380
    Purity: 95%
    MF: C12H8N2O2
    MW: 212.208
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1=CC2=C(N1)C1=NC=CC=C1C=C2
  5. 5-chloro-5-ethyl-1H-pyrrolo[3,2,1-ij]quinoline-4,6(2H,5H)-dione

    CAS No.: 603-37-2
    Catalog No.: 178290
    Purity: 95%
    MF: C13H12ClNO2
    MW: 249.697
    Storage: 2-8 degree Celsius
    SMILES: CCC1(Cl)C(=O)N2CCC3=CC=CC(=C23)C1=O
  6. 4-chloro-1-methyl-6-nitropyrrolo[4,3,2-de]quinolin-2(1H)-one

    CAS No.: 1966966-31-3
    Catalog No.: TQR1385
    Purity: 95%
    MF: C11H6ClN3O3
    MW: 263.64
    Storage: 2-8 degree Celsius
    SMILES: ClC=1N=C2C(=CC=C3C2=C(C1)C(N3C)=O)[N+](=O)[O-]
  7. 4-chloro-1-methylpyrrolo[4,3,2-de]quinolin-2(1H)-one

    CAS No.: 1863980-15-7
    Catalog No.: TQR1384
    Purity: 95%
    MF: C11H7ClN2O
    MW: 218.643
    Storage: 2-8 degree Celsius
    SMILES: ClC=1N=C2C=CC=C3C2=C(C1)C(N3C)=O
  8. 1-methylpyrrolo[4,3,2-de]quinoline-2,4(1H,5H)-dione

    CAS No.: 1863980-14-6
    Catalog No.: TQR1383
    Purity: 95%
    MF: C11H8N2O2
    MW: 200.197
    Storage: 2-8 degree Celsius
    SMILES: CN1C(C2=CC(NC=3C=CC=C1C23)=O)=O
  9. (S)-1-(3-aminophenyl)-3a-hydroxy-6-methyl-3,3a-dihydro-1H-pyrrolo[2,3-b]quinolin-4(2H)-one

    CAS No.: 2097141-18-7
    Catalog No.: TQR0308
    Purity: 95%
    MF: C18H17N3O2
    MW: 307.353
    Storage: 2-8 degree Celsius
    SMILES: NC=1C=C(C=CC1)N1CC[C@@]2(C1=NC1=CC=C(C=C1C2=O)C)O
  10. (S)-3a-hydroxy-1-(3-hydroxyphenyl)-6-methyl-3,3a-dihydro-1H-pyrrolo[2,3-b]quinolin-4(2H)-one

    CAS No.: 2097136-42-8
    Catalog No.: TQR0307
    Purity: 95%
    MF: C18H16N2O3
    MW: 308.337
    Storage: 2-8 degree Celsius
    SMILES: O[C@@]12C(=NC3=CC=C(C=C3C1=O)C)N(CC2)C2=CC(=CC=C2)O
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 21 total

  1. 1
  2. 2
  3. 3