•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyrrolopyrroles

Set Ascending Direction

   

Items 31 to 40 of 47 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. tert-butyl 1-benzylhexahydropyrrolo[3,4-b]pyrrole-5(1H)-carboxylate

    CAS No.: 132414-80-3
    Catalog No.: 133616
    Purity: 95%
    MF: C18H26N2O2
    MW: 302.418
    Storage: 2-8 degree Celsius
  2. tert-butyl hexahydropyrrolo[3,4-b]pyrrole-5(1H)-carboxylate

    CAS No.: 132414-81-4
    Catalog No.: 133617
    Purity: 95%
    MF: C11H20N2O2
    MW: 212.293
    Storage: 2-8 degree Celsius
  3. tert-butyl 5-(2,2,2-trifluoroacetyl)hexahydropyrrolo[3,4-b]pyrrole-1(2H)-carboxylate

    CAS No.: 1279815-99-4
    Catalog No.: 133618
    Purity: 95%
    MF: C13H19F3N2O3
    MW: 308.3
    Storage: 2-8 degree Celsius
  4. tert-butyl hexahydropyrrolo[3,4-b]pyrrole-1(2H)-carboxylate

    CAS No.: 185693-02-1
    Catalog No.: 133619
    Purity: 95%
    MF: C11H20N2O2
    MW: 212.293
    Storage: 2-8 degree Celsius
  5. 1-(1-benzylhexahydropyrrolo[3,4-b]pyrrol-5(1H)-yl)-2,2,2-trifluoroethan-1-one

    CAS No.: 1279822-87-5
    Catalog No.: 135083
    Purity: 95%
    MF: C15H17F3N2O
    MW: 298.308
    Storage: 2-8 degree Celsius
  6. tert-butyl hexahydropyrrolo[3,4-c]pyrrole-2(1H)-carboxylate

    CAS No.: 141449-85-6
    Catalog No.: 138863
    Purity: 95%
    MF: C11H20N2O2
    MW: 212.293
    Storage: 2-8 degree Celsius
  7. (3aR,6aS)-2-benzyloctahydropyrrolo[3,4-c]pyrrole

    CAS No.: 172739-04-7
    Catalog No.: 106523
    Purity: 95%
    MF: C13H18N2
    MW: 202.301
    Storage: 2-8 degree Celsius
  8. tert-butyl 5-benzylhexahydropyrrolo[3,4-c]pyrrole-2(1H)-carboxylate

    CAS No.: 186202-73-3
    Catalog No.: 148696
    Purity: 95%
    MF: C18H26N2O2
    MW: 302.418
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)N1CC2CN(CC3=CC=CC=C3)CC2C1
  9. (3aR,6aS)-tert-butyl 5-benzylhexahydropyrrolo[3,4-c]pyrrole-2(1H)-carboxylate

    CAS No.: 370879-56-4
    Catalog No.: 148697
    Purity: 95%
    MF: C18H26N2O2
    MW: 302.418
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)N1C[C@@H]2CN(CC3=CC=CC=C3)C[C@H]2C1
  10. 2-methyl-octahydropyrrolo[3,4-c]pyrrole

    CAS No.: 86732-28-7
    Catalog No.: 164519
    Purity: 95%
    MF: C7H14N2
    MW: 126.203
    Storage: 2-8 degree Celsius
    SMILES: CN1CC2CNCC2C1
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 40 of 47 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5