•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyrrolopyrroles

Set Ascending Direction

   

Items 21 to 30 of 47 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. cis-5-benzyl-3a,6a-dimethyl-2,3,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrole

    CAS No.: 2574525-04-3
    Catalog No.: 197673
    Purity: 95%
    MF: C15H22N2
    MW: 230.355
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)N1C[C@@]2([C@](C1)(CNC2)C)C
  2. 5,5-dimethyl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole

    CAS No.: 1447997-32-1
    Catalog No.: 198025
    Purity: 95%
    MF: C8H12N2
    MW: 136.198
    Storage: 2-8 degree Celsius
    SMILES: CC1(CC=2N(N=CC2)C1)C
  3. 3-bromo-5,5-dimethyl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole

    CAS No.: 2057507-56-7
    Catalog No.: 198036
    Purity: 95%
    MF: C8H11BrN2
    MW: 215.094
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C2N(N=C1)CC(C2)(C)C
  4. tert-butyl cis-3a,6a-dimethyl-2,3,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxylate

    CAS No.: 2035072-26-3
    Catalog No.: 199092
    Purity: 95%
    MF: C13H24N2O2
    MW: 240.347
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)OC(=O)N1C[C@@]2([C@](C1)(CNC2)C)C
  5. Octahydropyrrolo[3,4-c]pyrrole

    CAS No.: 5840-00-6
    Catalog No.: 139223
    Purity: 95%
    MF: C6H12N2
    MW: 112.176
    Storage: 2-8 degree Celsius
    SMILES: C1NCC2CNCC12
  6. (3aR,6aS)-tert-butyl hexahydropyrrolo[3,4-c]pyrrole-2(1H)-carboxylate

    CAS No.: 250275-15-1
    Catalog No.: 106524
    Purity: 95%
    MF: C11H20N2O2
    MW: 212.293
    Storage: 2-8 degree Celsius
  7. 5-benzyl-2-phenyltetrahydropyrrolo[3,4-c]pyrrole-1,3-dione

    CAS No.: 93102-03-5
    Catalog No.: 109628
    Purity: 95%
    MF: C19H18N2O2
    MW: 306.365
    Storage: 2-8 degree Celsius
  8. 3,6-di(2-thienyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione

    CAS No.: 850583-75-4
    Catalog No.: 110782
    Purity: 95%
    MF: C14H8N2O2S2
    MW: 300.364
    Storage: 2-8 degree Celsius
    SMILES: O=C1NC(C2=CC=CS2)=C2C(=O)NC(C3=CC=CS3)=C12
  9. ethyl 1-benzylhexahydropyrrolo[3,4-b]pyrrole-5(1H)-carboxylate

    CAS No.: 132414-78-9
    Catalog No.: 133614
    Purity: 95%
    MF: C16H22N2O2
    MW: 274.364
    Storage: 2-8 degree Celsius
  10. 1-benzyloctahydropyrrolo[3,4-b]pyrrole

    CAS No.: 132414-50-7
    Catalog No.: 133615
    Purity: 95%
    MF: C13H18N2
    MW: 202.301
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Ascending Direction

   

Items 21 to 30 of 47 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5