•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyrrolopyrroles

Set Descending Direction

   

Items 1 to 10 of 47 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 2-propyl-octahydropyrrolo[3,4-c]pyrrole

    CAS No.: 954241-17-9
    Catalog No.: 164398
    Purity: 95%
    MF: C9H18N2
    MW: 154.257
    Storage: 2-8 degree Celsius
    SMILES: CCCN1CC2CNCC2C1
  2. tert-butyl octahydropyrrolo[3,4-c]pyrrole-2-carboxylate oxalate(2:1)

    CAS No.: 1630907-05-9
    Catalog No.: 170676
    Purity: 95%
    MF: C24H40N4O8-2
    MW: 512.604
    Storage: 2-8 degree Celsius
    SMILES: [O-]C(=O)C([O-])=O.CC(C)(C)OC(=O)N1CC2CNCC2C1.CC(C)(C)OC(=O)N1CC2CNCC2C1
  3. tert-butyl (3aR,6aS)-4,6-dioxohexahydropyrrolo[3,4-c]pyrrole-2(1H)-carboxylate

    CAS No.: 1251003-99-2
    Catalog No.: 171310
    Purity: 95%
    MF: C11H16N2O4
    MW: 240.259
    Storage: 2-8 degree Celsius
    SMILES: [H][C@@]12CN(C[C@]1([H])C(=O)NC2=O)C(=O)OC(C)(C)C
  4. (3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole

    CAS No.: 876130-70-0
    Catalog No.: 182319
    Purity: 95%
    MF: C7H14N2
    MW: 126.203
    Storage: 2-8 degree Celsius
    SMILES: CN1C[C@@H]2CCN[C@@H]2C1
  5. 5-methyloctahydropyrrolo[3,4-b]pyrrole

    CAS No.: 132414-59-6
    Catalog No.: 186738
    Purity: 95%
    MF: C7H14N2
    MW: 126.203
    Storage: 2-8 degree Celsius
    SMILES: CN1CC2NCCC2C1
  6. tert-Butyl rac-(4aS,7aS)-hexahydropyrrolo[3,4-b][1,4]oxazine-4(4aH)-carboxylate

    CAS No.: 1260116-95-7
    Catalog No.: 192572
    Purity: 95%
    MF: C11H20N2O3
    MW: 228.292
    Storage: 2-8 degree Celsius
    SMILES: O1C2C(N(CC1)C(=O)OC(C)(C)C)CNC2
  7. trans-tert-butyl hexahydropyrrolo[3,4-b][1,4]oxazine-6(2H)-carboxylate

    CAS No.: 138026-93-4
    Catalog No.: 192573
    Purity: 95%
    MF: C11H20N2O3
    MW: 228.292
    Storage: 2-8 degree Celsius
    SMILES: O1[C@H]2[C@H](NCC1)CN(C2)C(=O)OC(C)(C)C
  8. methyl 3,3a,4,5,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-2-carboxylate

    CAS No.: 1443664-03-6
    Catalog No.: 194390
    Purity: 95%
    MF: C8H14N2O2
    MW: 170.212
    Storage: 2-8 degree Celsius
    SMILES: C1N(CC2C1CNC2)C(=O)OC
  9. (3aR,6aR)-tert-butyl hexahydropyrrolo[3,2-b]pyrrole-1(2H)-carboxylate

    CAS No.: 1260590-44-0
    Catalog No.: ZB2220
    Purity: 95%
    MF: C11H20N2O2
    MW: 212.293
    Storage: 2-8 degree Celsius
    SMILES: N1([C@H]2[C@@H](CC1)NCC2)C(=O)OC(C)(C)C
  10. 5-benzyltetrahydropyrrolo[3,4-c]pyrrole-1,3(2H,3aH)-dione

    CAS No.: 848591-86-6
    Catalog No.: 149374
    Purity: 95%
    MF: C13H14N2O2
    MW: 230.267
    Storage: 2-8 degree Celsius
    SMILES: O=C1NC(=O)C2CN(CC3=CC=CC=C3)CC12
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 47 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5