•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyrrolopyridines

Set Descending Direction

   

Items 31 to 40 of 354 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6
  1. 2-chloro-6-(1H-pyrazol-4-yl)-6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-5-one

    CAS No.: 1315545-03-9
    Catalog No.: TQR0605
    Purity: 95%
    MF: C10H7ClN4O
    MW: 234.646
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=C2C(=N1)CN(C2=O)C=2C=NNC2
  2. 4-chloro-5-nitro-1-tosyl-1H-pyrrolo[2,3-b]pyridine

    CAS No.: 1421338-17-1
    Catalog No.: TQR0626
    Purity: 95%
    MF: C14H10ClN3O4S
    MW: 351.771
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C2C(=NC=C1[N+](=O)[O-])N(C=C2)S(=O)(=O)C2=CC=C(C)C=C2
  3. 4-chloro-5-nitro-1H-pyrrolo[2,3-b]pyridine

    CAS No.: 1245645-97-9
    Catalog No.: TQR0627
    Purity: 95%
    MF: C7H4ClN3O2
    MW: 197.581
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C2C(=NC=C1[N+](=O)[O-])NC=C2
  4. N4-cyclohexyl-1-tosyl-1H-pyrrolo[2,3-b]pyridine-4,5-diamine

    CAS No.: 1310730-49-4
    Catalog No.: TQR0628
    Purity: 95%
    MF: C20H24N4O2S
    MW: 384.505
    Storage: 2-8 degree Celsius
    SMILES: C1(CCCCC1)NC1=C2C(=NC=C1N)N(C=C2)S(=O)(=O)C2=CC=C(C)C=C2
  5. (6-(4-fluorobenzyl)-3,3-dimethyl-2,3-dihydro-1H-pyrrolo[3,2-b]pyridin-5-yl)methanol

    CAS No.: 1799327-42-6
    Catalog No.: TQR0885
    Purity: 95%
    MF: C17H19FN2O
    MW: 286.35
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC=C(CC=2C=C3C(=NC2CO)C(CN3)(C)C)C=C1
  6. 5-bromo-6-(4-fluorobenzyl)-3,3-dimethyl-2,3-dihydro-1H-pyrrolo[3,2-b]pyridine

    CAS No.: 1799327-37-9
    Catalog No.: TQR0886
    Purity: 95%
    MF: C16H16BrFN2
    MW: 335.22
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(C=C2C(=N1)C(CN2)(C)C)CC2=CC=C(C=C2)F
  7. 6-(4-fluorobenzyl)-3,3-dimethyl-2,3-dihydro-1H-pyrrolo[3,2-b]pyridine

    CAS No.: 1403903-11-6
    Catalog No.: TQR0887
    Purity: 95%
    MF: C16H17FN2
    MW: 256.324
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC=C(CC=2C=C3C(=NC2)C(CN3)(C)C)C=C1
  8. (2R,3R,4S,5R)-2-(4-amino-3-chloro-1H-pyrrolo[2,3-b]pyridin-1-yl)-5-(hydroxymethyl)tetrahydrofuran-3,4-diol

    CAS No.: 2307607-76-5
    Catalog No.: TQR1142
    Purity: 95%
    MF: C12H14ClN3O4
    MW: 299.714
    Storage: 2-8 degree Celsius
    SMILES: NC1=C2C(=NC=C1)N(C=C2Cl)[C@@H]2O[C@@H]([C@H]([C@H]2O)O)CO
  9. (2R,3R,4S,5R)-2-(4-amino-3-bromo-1H-pyrrolo[2,3-b]pyridin-1-yl)-5-(hydroxymethyl)tetrahydrofuran-3,4-diol

    CAS No.: 2307607-77-6
    Catalog No.: TQR1143
    Purity: 95%
    MF: C12H14BrN3O4
    MW: 344.165
    Storage: 2-8 degree Celsius
    SMILES: NC1=C2C(=NC=C1)N(C=C2Br)[C@@H]2O[C@@H]([C@H]([C@H]2O)O)CO
  10. (2R,3R,4S,5R)-2-(4-amino-3-iodo-1H-pyrrolo[2,3-b]pyridin-1-yl)-5-(hydroxymethyl)tetrahydrofuran-3,4-diol

    CAS No.: 2307607-78-7
    Catalog No.: TQR1144
    Purity: 95%
    MF: C12H14IN3O4
    MW: 391.165
    Storage: 2-8 degree Celsius
    SMILES: NC1=C2C(=NC=C1)N(C=C2I)[C@@H]2O[C@@H]([C@H]([C@H]2O)O)CO
Loading ...Load More ...
Set Descending Direction

   

Items 31 to 40 of 354 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6