•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyrrolopyridines

Set Descending Direction

   

Items 1 to 10 of 1013 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 5-chloro-1H-pyrrolo[2,3-c]pyridine

    CAS No.: 131084-55-4
    Catalog No.: 100186
    Purity: 95%
    MF: C7H5ClN2
    MW: 152.584
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC2=C(NC=C2)C=N1
  2. 5-chloro-1-isopropyl-1H-pyrrolo[2,3-c]pyridine

    CAS No.: 1221153-79-2
    Catalog No.: 100187
    Purity: 95%
    MF: C10H11ClN2
    MW: 194.665
    Storage: 2-8 degree Celsius
    SMILES: CC(C)N1C=CC2=C1C=NC(Cl)=C2
  3. 1-(5-chloro-1-isopropyl-1H-pyrrolo[2,3-c]pyridin-3-yl)ethanone

    CAS No.: 1221153-80-5
    Catalog No.: 100188
    Purity: 95%
    MF: C12H13ClN2O
    MW: 236.702
    Storage: 2-8 degree Celsius
    SMILES: CC(C)N1C=C(C(C)=O)C2=C1C=NC(Cl)=C2
  4. (E)-1-(5-chloro-1-isopropyl-1H-pyrrolo[2,3-c]pyridin-3-yl)-3-(dimethylamino)prop-2-en-1-one

    CAS No.: 1221153-81-6
    Catalog No.: 100189
    Purity: 95%
    MF: C15H18ClN3O
    MW: 291.782
    Storage: 2-8 degree Celsius
  5. 5-chloro-1H-pyrrolo[3,2-b]pyridine

    CAS No.: 65156-94-7
    Catalog No.: 100190
    Purity: 95%
    MF: C7H5ClN2
    MW: 152.584
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=C2NC=CC2=N1
  6. 1H-pyrrolo[3,2-b]pyridine-5-carbonitrile

    CAS No.: 146767-63-7
    Catalog No.: 100191
    Purity: 95%
    MF: C8H5N3
    MW: 143.149
    Storage: 2-8 degree Celsius
    SMILES: N#CC1=CC=C2NC=CC2=N1
  7. tert-butyl 5-cyano-1H-pyrrolo[3,2-b]pyridine-1-carboxylate

    CAS No.: 1364663-38-6
    Catalog No.: 100192
    Purity: 95%
    MF: C13H13N3O2
    MW: 243.266
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)N1C=CC2=NC(=CC=C12)C#N
  8. tert-butyl 5-propionyl-1H-pyrrolo[3,2-b]pyridine-1-carboxylate

    CAS No.: 1407180-80-6
    Catalog No.: 100557
    Purity: 95%
    MF: C15H18N2O3
    MW: 274.32
    Storage: 2-8 degree Celsius
    SMILES: CCC(=O)C1=CC=C2N(C=CC2=N1)C(=O)OC(C)(C)C
  9. (S)-1-(1H-pyrrolo[3,2-b]pyridin-5-yl)propan-1-amine hydrochloride

    CAS No.: 1422143-35-8
    Catalog No.: 100558
    Purity: 95%
    MF: C10H14ClN3
    MW: 211.696
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].CC[C@H](N)C1=CC=C2NC=CC2=N1
  10. 4-(5-chloro-1-isopropyl-1H-pyrrolo[2,3-c]pyridin-3-yl)pyrimidin-2-amine

    CAS No.: 1221153-82-7
    Catalog No.: 100842
    Purity: 95%
    MF: C14H14ClN5
    MW: 287.754
    Storage: 2-8 degree Celsius
    SMILES: CC(C)N1C=C(C2=C1C=NC(Cl)=C2)C1=NC(N)=NC=C1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 1013 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5