•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyrrolopyridines

Set Ascending Direction

   

Items 41 to 50 of 1013 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7
  1. 1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid

    CAS No.: 479553-01-0
    Catalog No.: 103725
    Purity: 95%
    MF: C8H6N2O2
    MW: 162.148
    Storage: 2-8 degree Celsius
  2. 1H-pyrrolo[2,3-c]pyridine-2-carbaldehyde

    CAS No.: 867034-96-6
    Catalog No.: 103726
    Purity: 95%
    MF: C8H6N2O
    MW: 146.149
    Storage: 2-8 degree Celsius
  3. 1H-pyrrolo[2,3-c]pyridine-2-carboxylic acid

    CAS No.: 24334-20-1
    Catalog No.: 103727
    Purity: 95%
    MF: C8H6N2O2
    MW: 162.148
    Storage: 2-8 degree Celsius
  4. 1H-pyrrolo[3,2-b]pyridin-3-amine dihydrochloride

    CAS No.: 1257535-39-9
    Catalog No.: 103728
    Purity: 95%
    MF: C7H9Cl2N3
    MW: 206.076
    Storage: 2-8 degree Celsius
  5. 1H-pyrrolo[3,2-c]pyridin-3-amine

    CAS No.: 1000342-62-0
    Catalog No.: 103729
    Purity: 95%
    MF: C7H7N3
    MW: 133.154
    Storage: 2-8 degree Celsius
  6. 1H-pyrrolo[3,2-c]pyridine-3-carbaldehyde

    CAS No.: 933717-10-3
    Catalog No.: 103730
    Purity: 95%
    MF: C8H6N2O
    MW: 146.149
    Storage: 2-8 degree Celsius
    SMILES: O=CC1=CNC2=C1C=NC=C2
  7. 2-(2,6-dichlorophenyl)-2,3-dihydro-3-hydroxypyrrolo[3,4-c]pyridin-1-one

    CAS No.: 1337881-94-3
    Catalog No.: 103775
    Purity: 95%
    MF: C13H8Cl2N2O2
    MW: 295.125
    Storage: 2-8 degree Celsius
  8. 2-(2,6-dichlorophenyl)-2,3-dihydropyrrolo[3,4-c]pyridin-1-one

    CAS No.: 1337881-43-2
    Catalog No.: 103776
    Purity: 95%
    MF: C13H8Cl2N2O
    MW: 279.126
    Storage: 2-8 degree Celsius
  9. tert-butyl 4-chloro-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine-1-carboxylate

    CAS No.: 494767-22-5
    Catalog No.: 104323
    Purity: 95%
    MF: C12H15ClN2O2
    MW: 254.717
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)N1CCC2=C1C=CN=C2Cl
  10. tert-butyl 4-amino-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine-1-carboxylate

    CAS No.: 494767-23-6
    Catalog No.: 104324
    Purity: 95%
    MF: C12H17N3O2
    MW: 235.287
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Ascending Direction

   

Items 41 to 50 of 1013 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7