•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyrrolopyridines

Set Ascending Direction

   

Items 21 to 30 of 354 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 4-chloro-1H-pyrrolo[3,2-c]pyridine-3-carbaldehyde

    CAS No.: 1190317-34-0
    Catalog No.: TQP0475
    Purity: 95%
    MF: C8H5ClN2O
    MW: 180.594
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=CC2=C1C(=CN2)C=O
  2. methyl 4,6-dichloro-1H-pyrrolo[3,2-c]pyridine-2-carboxylate

    CAS No.: 871583-20-9
    Catalog No.: TQP0476
    Purity: 95%
    MF: C9H6Cl2N2O2
    MW: 245.065
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC(=CC2=C1C=C(N2)C(=O)OC)Cl
  3. 4-chloro-7-methyl-1H-pyrrolo[3,2-c]pyridine

    CAS No.: 1082040-95-6
    Catalog No.: TQP0477
    Purity: 95%
    MF: C8H7ClN2
    MW: 166.611
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=C(C2=C1C=CN2)C
  4. 4-chloro-2,6-dimethyl-1H-pyrrolo[3,2-c]pyridine

    CAS No.: 146398-90-5
    Catalog No.: TQP0478
    Purity: 95%
    MF: C9H9ClN2
    MW: 180.638
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC(=CC2=C1C=C(N2)C)C
  5. 4-chloro-2,3-dimethyl-1H-pyrrolo[3,2-c]pyridine

    CAS No.: 878232-70-3
    Catalog No.: TQP0479
    Purity: 95%
    MF: C9H9ClN2
    MW: 180.638
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=CC2=C1C(=C(N2)C)C
  6. 6-bromo-3,3-dimethyl-2,3-dihydro-1H-pyrrolo[3,2-b]pyridine

    CAS No.: 1259512-11-2
    Catalog No.: TQP0804
    Purity: 95%
    MF: C9H11BrN2
    MW: 227.105
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C2C(=NC1)C(CN2)(C)C
  7. tert-butyl 6-bromo-3,3-dimethyl-2,3-dihydro-1H-pyrrolo[3,2-b]pyridine-1-carboxylate

    CAS No.: 1403901-49-4
    Catalog No.: TQP0805
    Purity: 95%
    MF: C14H19BrN2O2
    MW: 327.222
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C2C(=NC1)C(CN2C(=O)OC(C)(C)C)(C)C
  8. 4-bromo-6-(but-3-en-1-yl)-1H-pyrrolo[2,3-c]pyridin-7(6H)-one

    CAS No.: 2265235-96-7
    Catalog No.: TQR0396
    Purity: 95%
    MF: C11H11BrN2O
    MW: 267.126
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C2=C(C(N(C1)CCC=C)=O)NC=C2
  9. 7-chloro-4-methoxy-1H-pyrrolo[2,3-c]pyridine

    CAS No.: 446284-32-8
    Catalog No.: TQR0540
    Purity: 95%
    MF: C8H7ClN2O
    MW: 182.61
    Storage: 2-8 degree Celsius
    SMILES: ClC=1N=CC(=C2C1NC=C2)OC
  10. methyl 2-(7-chloro-4-methoxy-1H-pyrrolo[2,3-c]pyridin-3-yl)-2-oxoacetate

    CAS No.: 446284-68-0
    Catalog No.: TQR0541
    Purity: 95%
    MF: C11H9ClN2O4
    MW: 268.656
    Storage: 2-8 degree Celsius
    SMILES: ClC=1N=CC(=C2C1NC=C2C(C(=O)OC)=O)OC
Loading ...Load More ...
Set Ascending Direction

   

Items 21 to 30 of 354 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5