•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyrrolopyrazines

Set Descending Direction

   

Items 31 to 40 of 88 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6
  1. 6-(2,6-dioxopiperidin-3-yl)-2-(piperazin-1-yl)-5H-pyrrolo[3,4-b]pyrazine-5,7(6H)-dione hydrochloride

    CAS No.: 2222117-40-8
    Catalog No.: 199612
    Purity: 95%
    MF: C15H17ClN6O4
    MW: 380.792
    Storage: 2-8 degree Celsius
    SMILES: Cl.O=C1NC(CCC1N1C(C2=NC(=CN=C2C1=O)N1CCNCC1)=O)=O
  2. 2,3-dichloro-6-(2,6-dioxopiperidin-3-yl)-5H-pyrrolo[3,4-b]pyrazine-5,7(6H)-dione

    CAS No.: 2983951-37-5
    Catalog No.: 199586
    Purity: 95%
    MF: C11H6Cl2N4O4
    MW: 329.099
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(N=C2C(=N1)C(N(C2=O)C2C(NC(CC2)=O)=O)=O)Cl
  3. (3S,8aS)-3-methyloctahydropyrrolo[1,2-a]pyrazine

    CAS No.: 179457-89-7
    Catalog No.: 199462
    Purity: 95%
    MF: C8H16N2
    MW: 140.23
    Storage: 2-8 degree Celsius
    SMILES: C[C@@H]1NC[C@H]2N(C1)CCC2
  4. tert-butyl 1H,2H,3H,4H-pyrrolo[1,2-a]pyrazine-2-carboxylate

    CAS No.: 1174068-78-0
    Catalog No.: 171549
    Purity: 95%
    MF: C12H18N2O2
    MW: 222.288
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)N1CCN2C=CC=C2C1
  5. 3-fluoro-7-iodo-5H-pyrrolo[2,3-b]pyrazine

    CAS No.: 2375919-18-7
    Catalog No.: GS3990
    Purity: 95%
    MF: C6H3FIN3
    MW: 263.013
    Storage: 2-8 degree Celsius
    SMILES: FC1=CN=C2C(=N1)NC=C2I
  6. 2-fluoro-7-iodo-5H-pyrrolo[2,3-b]pyrazine

    CAS No.: 2230713-64-9
    Catalog No.: GS3989
    Purity: 95%
    MF: C6H3FIN3
    MW: 263.013
    Storage: 2-8 degree Celsius
    SMILES: FC=1N=C2C(=NC1)NC=C2I
  7. 7-bromo-3-chloro-5H-pyrrolo[2,3-b]pyrazine

    CAS No.: 1935445-26-3
    Catalog No.: GS3850
    Purity: 95%
    MF: C6H3BrClN3
    MW: 232.468
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CNC2=NC(=CN=C21)Cl
  8. 3-chloro-7-iodo-5H-pyrrolo[2,3-b]pyrazine

    CAS No.: 1581750-56-2
    Catalog No.: GS3849
    Purity: 95%
    MF: C6H3ClIN3
    MW: 279.468
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CN=C2C(=N1)NC=C2I
  9. 6-phenyl-5H-pyrrolo[2,3-b]pyrazine

    CAS No.: 78605-10-4
    Catalog No.: 196486
    Purity: 95%
    MF: C12H9N3
    MW: 195.225
    Storage: 2-8 degree Celsius
    SMILES: C1(=CC=CC=C1)C1=CC=2C(=NC=CN2)N1
  10. 2-bromo-6-methyl-5H-pyrrolo[2,3-b]pyrazine

    CAS No.: 1228450-58-5
    Catalog No.: 195742
    Purity: 95%
    MF: C7H6BrN3
    MW: 212.05
    Storage: 2-8 degree Celsius
    SMILES: BrC=1N=C2C(=NC1)NC(=C2)C
Loading ...Load More ...
Set Descending Direction

   

Items 31 to 40 of 88 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6