•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyrrolopyrazines

Set Ascending Direction

   

Items 11 to 20 of 88 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 2-bromo-5-((2-(trimethylsilyl)ethoxy)methyl)-5H-pyrrolo[2,3-b]pyrazine-7-carbaldehyde

    CAS No.: 1185428-34-5
    Catalog No.: TQP0766
    Purity: 95%
    MF: C13H18BrN3O2Si
    MW: 356.296
    Storage: 2-8 degree Celsius
    SMILES: BrC=1N=C2C(=NC1)N(C=C2C=O)COCC[Si](C)(C)C
  2. (7R,8aS)-octahydropyrrolo[1,2-a]pyrazin-7-ol

    CAS No.: 879399-07-2
    Catalog No.: LT0078
    Purity: 95%
    MF: C7H14N2O
    MW: 142.202
    Storage: 2-8 degree Celsius
    SMILES: C1[C@H]2N(CCN1)C[C@@H](C2)O
  3. 6-(5-chloropyridin-2-yl)-5H-pyrrolo[3,4-b]pyrazine-5,7(6H)-dione

    CAS No.: 43200-82-4
    Catalog No.: LT0276
    Purity: 95%
    MF: C11H5ClN4O2
    MW: 260.64
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=CC(=NC1)N1C(C2=NC=CN=C2C1=O)=O
  4. 6-(5-chloropyridin-2-yl)-7-hydroxy-6,7-dihydro-5H-pyrrolo[3,4-b]pyrazin-5-one

    CAS No.: 43200-81-3
    Catalog No.: LT0275
    Purity: 95%
    MF: C11H7ClN4O2
    MW: 262.656
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=CC(=NC1)N1C(C2=NC=CN=C2C1=O)O
  5. dihydro-1H-pyrrolo[1,2-a]thiazolo[3,4-d]pyrazine-5,8,10(3H,5aH,10aH)-trione

    CAS No.: 161771-76-2
    Catalog No.: LT0146
    Purity: 95%
    MF: C9H10N2O3S
    MW: 226.257
    Storage: 2-8 degree Celsius
    SMILES: C1SCN2C(C3N(C(C21)=O)C(CC3)=O)=O
  6. 7,7-dimethyl-2,3,4,6,7,8-hexahydro-1H-cyclopenta[4,5]pyrrolo[1,2-a]pyrazin-1-one

    CAS No.: 1346674-23-4
    Catalog No.: HKP0021
    Purity: 95%
    MF: C12H16N2O
    MW: 204.273
    Storage: 2-8 degree Celsius
    SMILES: CC1(CC2=C(C=C3N2CCNC3=O)C1)C
  7. tert-butyl 6-oxo-hexahydropyrrolo[1,2-a]pyrazine-2(1H)-carboxylate

    CAS No.: 1429200-16-7
    Catalog No.: 193058
    Purity: 95%
    MF: C12H20N2O3
    MW: 240.303
    Storage: 2-8 degree Celsius
    SMILES: O=C1CCC2N1CCN(C2)C(=O)OC(C)(C)C
  8. 5H-pyrrolo[2,3-b]pyrazine-7-carbaldehyde

    CAS No.: 4121-22-6
    Catalog No.: 191245
    Purity: 95%
    MF: C7H5N3O
    MW: 147.137
    Storage: 2-8 degree Celsius
    SMILES: N1=C2C(=NC=C1)NC=C2C=O
  9. 1-(4,5-dihydro-1H-pyrrolo[2,3-b]pyrazin-7-yl)-N,N-dimethylmethanamine

    CAS No.: 1624261-12-6
    Catalog No.: 191180
    Purity: 95%
    MF: C9H14N4
    MW: 178.239
    Storage: 2-8 degree Celsius
    SMILES: N1C2=C(NC=C1)NC=C2CN(C)C
  10. 7,7-difluorotetrahydropyrrolo[1,2-a]pyrazine-1,3(2H,4H)-dione

    CAS No.: 1624260-16-7
    Catalog No.: 191175
    Purity: 95%
    MF: C7H8F2N2O2
    MW: 190.149
    Storage: 2-8 degree Celsius
    SMILES: FC1(CC2N(CC(NC2=O)=O)C1)F
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 88 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5