•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyrrolidines

Set Ascending Direction

   

Items 11 to 20 of 2643 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. (E)-3-(2-fluorophenyl)-2-methylacrylaldehyde

    CAS No.: 1375800-37-5
    Catalog No.: 101223
    Purity: 95%
    MF: C10H9FO
    MW: 164.179
    Storage: 2-8 degree Celsius
    SMILES: C\C(C=O)=C/C1=CC=CC=C1F
  2. (S)-3-hydroxypyrrolidin-2-one

    CAS No.: 34368-52-0
    Catalog No.: 101316
    Purity: 95%
    MF: C4H7NO2
    MW: 101.105
    Storage: 2-8 degree Celsius
  3. tert-butyl 3-oxopyrrolidine-1-carboxylate

    CAS No.: 101385-93-7
    Catalog No.: 101325
    Purity: 95%
    MF: C9H15NO3
    MW: 185.223
    Storage: 2-8 degree Celsius
  4. pyrrolidin-3-one hydrochloride

    CAS No.: 3760-52-9
    Catalog No.: 101326
    Purity: 95%
    MF: C4H8ClNO
    MW: 121.567
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].O=C1CCNC1
  5. (S)-1-(tert-butoxycarbonyl)-4-methylenepyrrolidine-2-carboxylic acid

    CAS No.: 84348-38-9
    Catalog No.: 101535
    Purity: 95%
    MF: C11H17NO4
    MW: 227.26
    Storage: 2-8 degree Celsius
  6. (2R)-2-ethyl-pyrrolidine

    CAS No.: 123168-37-6
    Catalog No.: 101563
    Purity: 95%
    MF: C6H13N
    MW: 99.177
    Storage: 2-8 degree Celsius
    SMILES: CC[C@@H]1CCCN1
  7. (R)-tert-butyl 2-ethylpyrrolidine-1-carboxylate

    CAS No.: 876617-06-0
    Catalog No.: 101568
    Purity: 95%
    MF: C11H21NO2
    MW: 199.294
    Storage: 2-8 degree Celsius
  8. (S)-2-(1-(tert-butoxycarbonyl)pyrrolidin-2-yl)acetic acid

    CAS No.: 56502-01-3
    Catalog No.: 102137
    Purity: 95%
    MF: C11H19NO4
    MW: 229.276
    Storage: 2-8 degree Celsius
  9. (2S)-2-(2-oxopyrrolidin-1-yl)butanoic acid

    CAS No.: 102849-49-0
    Catalog No.: 102185
    Purity: 95%
    MF: C8H13NO3
    MW: 171.196
    Storage: 2-8 degree Celsius
    SMILES: CC[C@H](N1CCCC1=O)C(O)=O
  10. (R)-N-Boc-3-pyrrolidineacetic acid

    CAS No.: 204688-60-8
    Catalog No.: 102202
    Purity: 95%
    MF: C11H19NO4
    MW: 229.276
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)N1CC[C@H](CC(O)=O)C1
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 2643 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5