•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyrimidines

Set Ascending Direction

   

Items 11 to 20 of 2535 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 4-amino-2-(methylthio)pyrimidine-5-carbaldehyde

    CAS No.: 770-31-0
    Catalog No.: 100061
    Purity: 95%
    MF: C6H7N3OS
    MW: 169.209
    Storage: 2-8 degree Celsius
    SMILES: CSC1=NC=C(C=O)C(N)=N1
  2. (E)-ethyl 3-(4-amino-2-(methylthio)pyrimidin-5-yl)acrylate

    CAS No.: 211244-80-3
    Catalog No.: 100062
    Purity: 95%
    MF: C10H13N3O2S
    MW: 239.3
    Storage: 2-8 degree Celsius
    SMILES: CCOC(=O)\C=C\C1=CN=C(SC)N=C1N
  3. 6-chloropyrimidine-4,5-diamine

    CAS No.: 4316-98-7
    Catalog No.: 100063
    Purity: 95%
    MF: C4H5ClN4
    MW: 144.565
    Storage: 2-8 degree Celsius
    SMILES: NC1=NC=NC(Cl)=C1N
  4. 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine

    CAS No.: 321724-19-0
    Catalog No.: 100064
    Purity: 95%
    MF: C10H15BN2O2
    MW: 206.054
    Storage: 2-8 degree Celsius
    SMILES: CC1(C)OB(OC1(C)C)C1=CN=CN=C1
  5. 2,5-dichloro-4-methoxypyrimidine

    CAS No.: 5750-74-3
    Catalog No.: 100065
    Purity: 95%
    MF: C5H4Cl2N2O
    MW: 179.006
    Storage: 2-8 degree Celsius
    SMILES: COC1=NC(Cl)=NC=C1Cl
  6. 4,6-dichloro-N-methylpyrimidin-2-amine

    CAS No.: 10397-15-6
    Catalog No.: 100066
    Purity: 95%
    MF: C5H5Cl2N3
    MW: 178.022
    Storage: 2-8 degree Celsius
    SMILES: CNC1=NC(Cl)=CC(Cl)=N1
  7. methyl 2,6-dichloro-5-nitropyrimidine-4-carboxylate

    CAS No.: 52047-13-9
    Catalog No.: 100067
    Purity: 95%
    MF: C6H3Cl2N3O4
    MW: 252.013
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)C1=NC(Cl)=NC(Cl)=C1[N+]([O-])=O
  8. 6-[bis(tert-butoxycarbonyl)amino]-4-chloropyrimidine

    CAS No.: 354112-08-6
    Catalog No.: 100068
    Purity: 95%
    MF: C14H20ClN3O4
    MW: 329.784
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)C1=CC(Cl)=NC=N1
  9. 6-[bis(tert-butoxycarbonyl)amino]-4-aminopyrimidine

    CAS No.: 1364663-35-3
    Catalog No.: 100069
    Purity: 95%
    MF: C14H22N4O4
    MW: 310.354
    Storage: 2-8 degree Celsius
  10. 6-chloro-2-methylpyrimidin-4-amine

    CAS No.: 1749-68-4
    Catalog No.: 100070
    Purity: 95%
    MF: C5H6ClN3
    MW: 143.577
    Storage: 2-8 degree Celsius
    SMILES: CC1=NC(Cl)=CC(N)=N1
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 2535 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5