•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyridopyrimidines

Set Descending Direction

   

Items 1 to 10 of 226 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 8-methoxypyrido[3,4-d]pyrimidin-4(3H)-one

    CAS No.: 1260178-71-9
    Catalog No.: 100227
    Purity: 95%
    MF: C8H7N3O2
    MW: 177.163
    Storage: 2-8 degree Celsius
    SMILES: COC1=NC=CC2=C1N=CNC2=O
  2. 4-chloro-8-methoxypyrido[3,4-d]pyrimidine

    CAS No.: 1260178-67-3
    Catalog No.: 100228
    Purity: 95%
    MF: C8H6ClN3O
    MW: 195.609
    Storage: 2-8 degree Celsius
    SMILES: COC1=NC=CC2=C(Cl)N=CN=C12
  3. 2-(methylthio)pyrido[2,3-d]pyrimidin-7(8H)-one

    CAS No.: 211244-81-4
    Catalog No.: 100229
    Purity: 95%
    MF: C8H7N3OS
    MW: 193.231
    Storage: 2-8 degree Celsius
    SMILES: CSC1=NC=C2C=CC(=O)NC2=N1
  4. 6-bromo-2-(methylthio)pyrido[2,3-d]pyrimidin-7(8H)-one

    CAS No.: 352328-87-1
    Catalog No.: 100230
    Purity: 95%
    MF: C8H6BrN3OS
    MW: 272.127
    Storage: 2-8 degree Celsius
    SMILES: CSC1=NC=C2C=C(Br)C(=O)NC2=N1
  5. 7-chloropyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione

    CAS No.: 938443-19-7
    Catalog No.: 100231
    Purity: 95%
    MF: C7H4ClN3O2
    MW: 197.581
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=C2C(=O)NC(=O)NC2=N1
  6. 2,4,7-trichloropyrido[2,3-d]pyrimidine

    CAS No.: 938443-20-0
    Catalog No.: 100232
    Purity: 90%
    MF: C7H2Cl3N3
    MW: 234.473
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC2=NC(Cl)=NC(Cl)=C2C=C1
  7. 4-(2,7-dichloropyrido[2,3-d]pyrimidin-4-yl)morpholine

    CAS No.: 938443-21-1
    Catalog No.: 100233
    Purity: 95%
    MF: C11H10Cl2N4O
    MW: 285.134
    Storage: 2-8 degree Celsius
  8. methyl 2-chloro-4-morpholinopyrido[2,3-d]pyrimidine-7-carboxylate

    CAS No.: 1227958-54-4
    Catalog No.: 100234
    Purity: 95%
    MF: C13H13ClN4O3
    MW: 308.725
    Storage: 2-8 degree Celsius
  9. (2-chloro-4-morpholinopyrido[2,3-d]pyrimidin-7-yl)methanol

    CAS No.: 1227958-02-2
    Catalog No.: 100235
    Purity: 95%
    MF: C12H13ClN4O2
    MW: 280.715
    Storage: 2-8 degree Celsius
  10. 4-(7-(bromomethyl)-2-chloropyrido[2,3-d]pyrimidin-4-yl)morpholine

    CAS No.: 1227958-17-9
    Catalog No.: 100236
    Purity: 95%
    MF: C12H12BrClN4O
    MW: 343.612
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 226 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5