•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyridopyridazines

Set Descending Direction

   

Items 1 to 10 of 12 total

  1. 1
  2. 2
  1. 1,4-dichloropyrido[4,3-d]pyridazine

    CAS No.: 14490-19-8
    Catalog No.: 111747
    Purity: 95%
    MF: C7H3Cl2N3
    MW: 200.028
    Storage: 2-8 degree Celsius
  2. 2,5,8-trichloropyrido[2,3-d]pyridazine

    CAS No.: 1268521-24-9
    Catalog No.: 133673
    Purity: 95%
    MF: C7H2Cl3N3
    MW: 234.473
    Storage: 2-8 degree Celsius
  3. 3-chloro-5,6,7,8-tetrahydropyrido[3,4-c]pyridazine

    CAS No.: 1029721-23-0
    Catalog No.: 137067
    Purity: 95%
    MF: C7H8ClN3
    MW: 169.615
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC2=C(CNCC2)N=N1
  4. 6,7-dihydro-pyrido[2,3-d]pyridazine-5,8-dione

    CAS No.: 4430-77-7
    Catalog No.: 137087
    Purity: 95%
    MF: C7H5N3O2
    MW: 163.136
    Storage: 2-8 degree Celsius
  5. 5-chloropyrido[3,2-d]pyridazin-8(7H)-one

    CAS No.: 23590-61-6
    Catalog No.: ZB0672
    Purity: 95%
    MF: C7H4ClN3O
    MW: 181.582
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NNC(C2=C1C=CC=N2)=O
  6. 8-oxo-7H,8H-pyrido[2,3-d]pyridazine-5-carboxylic acid

    CAS No.: 13629-38-4
    Catalog No.: 154445
    Purity: 95%
    MF: C8H5N3O3
    MW: 191.146
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1=NNC(=O)C2=C1C=CC=N2
  7. 2-methyl-5,6,7,8-tetrahydro-2H-pyrido[4,3-c]pyridazin-3-one

    CAS No.: 1341677-30-2
    Catalog No.: 164545
    Purity: 95%
    MF: C8H11N3O
    MW: 165.196
    Storage: 2-8 degree Celsius
    SMILES: CN1N=C2CCNCC2=CC1=O
  8. 8-oxo-7-phenyl-7H,8H-pyrido[2,3-d]pyridazine-5-carboxylic acid

    CAS No.: 13694-12-7
    Catalog No.: 153857
    Purity: 95%
    MF: C14H9N3O3
    MW: 267.244
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1=NN(C2=CC=CC=C2)C(=O)C2=C1C=CC=N2
  9. 2,3-dihydropyrido[4,3-d]pyridazine-1,4-dione

    CAS No.: 31384-08-4
    Catalog No.: WLZ2747
    Purity: 95%
    MF: C7H5N3O2
    MW: 163.136
    Storage: 2-8 degree Celsius
    SMILES: C1(NNC(C2=C1C=CN=C2)=O)=O
  10. 1,7-dichloro-4-methylpyrido[3,4-d]pyridazine

    CAS No.: 2654746-98-0
    Catalog No.: 197703
    Purity: 95%
    MF: C8H5Cl2N3
    MW: 214.055
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C2C(=C(N=N1)C)C=NC(=C2)Cl
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 12 total

  1. 1
  2. 2