•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyridoindoles

Set Ascending Direction

   

Items 41 to 43 of 43 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. tert-butyl 5-bromo-3,4-dihydro-1H-pyrido[3,4-b]indole-2(9H)-carboxylate

    CAS No.: 2251731-93-6
    Catalog No.: TQ0181
    Purity: 95%
    MF: C16H19BrN2O2
    MW: 351.244
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C2C3=C(NC2=CC=C1)CN(CC3)C(=O)OC(C)(C)C
  2. 8-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole

    CAS No.: 23046-76-6
    Catalog No.: TQ0182
    Purity: 95%
    MF: C11H11ClN2
    MW: 206.676
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=CC=C2C3=C(NC12)CNCC3
  3. tert-butyl 8-chloro-3,4-dihydro-1H-pyrido[3,4-b]indole-2(9H)-carboxylate

    CAS No.: 2251731-97-0
    Catalog No.: TQ0183
    Purity: 95%
    MF: C16H19ClN2O2
    MW: 306.793
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=CC=C2C3=C(NC12)CN(CC3)C(=O)OC(C)(C)C
Loading ...Load More ...
Set Ascending Direction

   

Items 41 to 43 of 43 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5