•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyridoindoles

Set Descending Direction

   

Items 1 to 10 of 64 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 2-phenyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole

    CAS No.: 111550-62-0
    Catalog No.: TQP1252
    Purity: 95%
    MF: C17H16N2
    MW: 248.329
    Storage: 2-8 degree Celsius
    SMILES: C1(=CC=CC=C1)N1CC=2NC3=CC=CC=C3C2CC1
  2. tert-butyl 5-bromo-3,4-dihydro-1H-pyrido[3,4-b]indole-2(9H)-carboxylate

    CAS No.: 2251731-93-6
    Catalog No.: TQ0181
    Purity: 95%
    MF: C16H19BrN2O2
    MW: 351.244
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C2C3=C(NC2=CC=C1)CN(CC3)C(=O)OC(C)(C)C
  3. 8-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole

    CAS No.: 23046-76-6
    Catalog No.: TQ0182
    Purity: 95%
    MF: C11H11ClN2
    MW: 206.676
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=CC=C2C3=C(NC12)CNCC3
  4. tert-butyl 8-chloro-3,4-dihydro-1H-pyrido[3,4-b]indole-2(9H)-carboxylate

    CAS No.: 2251731-97-0
    Catalog No.: TQ0183
    Purity: 95%
    MF: C16H19ClN2O2
    MW: 306.793
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=CC=C2C3=C(NC12)CN(CC3)C(=O)OC(C)(C)C
  5. 8-bromo-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole

    CAS No.: 171066-27-6
    Catalog No.: TQ0184
    Purity: 95%
    MF: C11H11BrN2
    MW: 251.127
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=CC=C2C3=C(NC12)CNCC3
  6. tert-butyl 8-bromo-3,4-dihydro-1H-pyrido[3,4-b]indole-2(9H)-carboxylate

    CAS No.: 1234687-92-3
    Catalog No.: TQ0185
    Purity: 95%
    MF: C16H19BrN2O2
    MW: 351.244
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=CC=C2C3=C(NC12)CN(CC3)C(=O)OC(C)(C)C
  7. tert-butyl 7-bromo-3,4-dihydro-1H-pyrido[3,4-b]indole-2(9H)-carboxylate

    CAS No.: 196203-96-0
    Catalog No.: TQP1240
    Purity: 95%
    MF: C16H19BrN2O2
    MW: 351.244
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=C2C3=C(NC2=C1)CN(CC3)C(=O)OC(C)(C)C
  8. tert-butyl 6-methoxy-3,4-dihydro-1H-pyrido[3,4-b]indole-2(9H)-carboxylate

    CAS No.: 1029578-08-2
    Catalog No.: TQP1241
    Purity: 95%
    MF: C17H22N2O3
    MW: 302.374
    Storage: 2-8 degree Celsius
    SMILES: COC=1C=C2C3=C(NC2=CC1)CN(CC3)C(=O)OC(C)(C)C
  9. tert-butyl 7-methoxy-3,4-dihydro-1H-pyrido[3,4-b]indole-2(9H)-carboxylate

    CAS No.: 1579291-66-9
    Catalog No.: TQP1242
    Purity: 95%
    MF: C17H22N2O3
    MW: 302.374
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=C2C3=C(NC2=C1)CN(CC3)C(=O)OC(C)(C)C
  10. tert-butyl 7-fluoro-3,4-dihydro-1H-pyrido[3,4-b]indole-2(9H)-carboxylate

    CAS No.: 2251731-96-9
    Catalog No.: TQP1243
    Purity: 95%
    MF: C16H19FN2O2
    MW: 290.338
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC=C2C3=C(NC2=C1)CN(CC3)C(=O)OC(C)(C)C
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 64 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5