•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyridines

Set Descending Direction

   

Items 1 to 10 of 12433 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 4,6-dichloronicotinaldehyde

    CAS No.: 1060811-62-2
    Catalog No.: 100001
    Purity: 95%
    MF: C6H3Cl2NO
    MW: 176.002
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=C(C=O)C(Cl)=C1
  2. 2,4-dichloronicotinaldehyde

    CAS No.: 134031-24-6
    Catalog No.: 100002
    Purity: 95%
    MF: C6H3Cl2NO
    MW: 176.002
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=NC(Cl)=C1C=O
  3. 5-bromo-2-chloroisonicotinaldehyde

    CAS No.: 1060802-23-4
    Catalog No.: 100003
    Purity: 95%
    MF: C6H3BrClNO
    MW: 220.453
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC(C=O)=C(Br)C=N1
  4. 2-chloro-5-fluoropyridin-4-amine

    CAS No.: 89510-90-7
    Catalog No.: 100004
    Purity: 95%
    MF: C5H4ClFN2
    MW: 146.552
    Storage: 2-8 degree Celsius
    SMILES: NC1=CC(Cl)=NC=C1F
  5. 2-chloro-5-fluoro-3-nitropyridin-4-amine

    CAS No.: 405230-90-2
    Catalog No.: 100005
    Purity: 95%
    MF: C5H3ClFN3O2
    MW: 191.549
    Storage: 2-8 degree Celsius
    SMILES: NC1=C(C(Cl)=NC=C1F)[N+]([O-])=O
  6. 2-amino-6-chloronicotinic acid

    CAS No.: 58584-92-2
    Catalog No.: 100006
    Purity: 95%
    MF: C6H5ClN2O2
    MW: 172.571
    Storage: 2-8 degree Celsius
    SMILES: NC1=C(C=CC(Cl)=N1)C(O)=O
  7. 2-amino-6-chloronicotinamide

    CAS No.: 64321-24-0
    Catalog No.: 100007
    Purity: 95%
    MF: C6H6ClN3O
    MW: 171.587
    Storage: 2-8 degree Celsius
    SMILES: NC(=O)C1=C(N)N=C(Cl)C=C1
  8. 2-bromo-6-chloropyridin-3-amine

    CAS No.: 1050501-88-6
    Catalog No.: 100008
    Purity: 95%
    MF: C5H4BrClN2
    MW: 207.458
    Storage: 2-8 degree Celsius
    SMILES: NC1=CC=C(Cl)N=C1Br
  9. tert-butyl 2-bromo-6-chloropyridin-3-ylcarbamate

    CAS No.: 1227958-32-8
    Catalog No.: 100009
    Purity: 95%
    MF: C10H12BrClN2O2
    MW: 307.575
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)NC1=CC=C(Cl)N=C1Br
  10. tert-butyl 6-chloro-2-formylpyridin-3-ylcarbamate

    CAS No.: 1199557-04-4
    Catalog No.: 100010
    Purity: 95%
    MF: C11H13ClN2O3
    MW: 256.689
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)NC1=CC=C(Cl)N=C1C=O
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 12433 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5