•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyridines

Set Ascending Direction

   

Items 1 to 10 of 4138 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 3-(pyridin-2-yl)-1H-pyrazol-4-amine

    CAS No.: 896467-81-5
    Catalog No.: 192888
    Purity: 95%
    MF: C8H8N4
    MW: 160.18
    Storage: 2-8 degree Celsius
    SMILES: N1=C(C=CC=C1)C1=NNC=C1N
  2. 5-tert-butylpicolinic acid

    CAS No.: 1005785-85-2
    Catalog No.: 192916
    Purity: 95%
    MF: C10H13NO2
    MW: 179.219
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)C=1C=CC(=NC1)C(=O)O
  3. 2-(pyridin-3-yl)cyclopropanecarboxylic acid

    CAS No.: 1017553-74-0
    Catalog No.: 192917
    Purity: 95%
    MF: C9H9NO2
    MW: 163.176
    Storage: 2-8 degree Celsius
    SMILES: N1=CC(=CC=C1)C1C(C1)C(=O)O
  4. 5-tert-butyl-2-chloropyridine

    CAS No.: 102236-19-1
    Catalog No.: 192918
    Purity: 95%
    MF: C9H12ClN
    MW: 169.655
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)C=1C=CC(=NC1)Cl
  5. (3-bromopyridin-2-yl)methanamine dihydrochloride

    CAS No.: 1052271-58-5
    Catalog No.: 192919
    Purity: 95%
    MF: C6H9BrCl2N2
    MW: 259.962
    Storage: 2-8 degree Celsius
    SMILES: Cl.Cl.BrC=1C(=NC=CC1)CN
  6. methyl 6-(aminomethyl)pyridine-3-carboxylate hydrochloride

    CAS No.: 1072438-56-2
    Catalog No.: 192920
    Purity: 95%
    MF: C8H11ClN2O2
    MW: 202.641
    Storage: 2-8 degree Celsius
    SMILES: Cl.NCC1=CC=C(C=N1)C(=O)OC
  7. methyl 2-acetylpyridine-3-carboxylate

    CAS No.: 111068-03-2
    Catalog No.: 192921
    Purity: 95%
    MF: C9H9NO3
    MW: 179.175
    Storage: 2-8 degree Celsius
    SMILES: C(C)(=O)C1=NC=CC=C1C(=O)OC
  8. trans-methyl 4-(pyridin-3-yl)pyrrolidine-3-carboxylate dihydrochloride

    CAS No.: 1217843-07-6
    Catalog No.: 192923
    Purity: 95%
    MF: C11H16Cl2N2O2
    MW: 279.167
    Storage: 2-8 degree Celsius
    SMILES: Cl.Cl.N1=CC(=CC=C1)[C@H]1[C@@H](CNC1)C(=O)OC
  9. 2-(tert-butoxycarbonyl)-6-chloronicotinic acid

    CAS No.: 1224194-44-8
    Catalog No.: 192924
    Purity: 95%
    MF: C11H12ClNO4
    MW: 257.673
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)OC(=O)C1=C(C(=O)O)C=CC(=N1)Cl
  10. 3-amino-6-hydroxypicolinic acid

    CAS No.: 1269291-72-6
    Catalog No.: 192925
    Purity: 95%
    MF: C6H6N2O3
    MW: 154.125
    Storage: 2-8 degree Celsius
    SMILES: NC=1C(=NC(=CC1)O)C(=O)O
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 4138 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5