•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyridazines

Set Ascending Direction

   

Items 21 to 30 of 264 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 2-(tert-butyl)-4-chloro-5-ethoxypyridazin-3(2H)-one

    CAS No.: 118827-40-0
    Catalog No.: TQP0453
    Purity: 95%
    MF: C10H15ClN2O2
    MW: 230.695
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)N1N=CC(=C(C1=O)Cl)OCC
  2. 5-(benzylamino)-2-(tert-butyl)-4-chloropyridazin-3(2H)-one

    CAS No.: 104564-75-2
    Catalog No.: TQP0455
    Purity: 95%
    MF: C15H18ClN3O
    MW: 291.782
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)NC1=C(C(N(N=C1)C(C)(C)C)=O)Cl
  3. 2-(tert-butyl)-4-chloro-5-((4-methoxybenzyl)amino)pyridazin-3(2H)-one

    CAS No.: 104564-83-2
    Catalog No.: TQP0456
    Purity: 95%
    MF: C16H20ClN3O2
    MW: 321.808
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)N1N=CC(=C(C1=O)Cl)NCC1=CC=C(C=C1)OC
  4. 4-bromo-2-(tetrahydro-2H-pyran-2-yl)pyridazin-3(2H)-one

    CAS No.: 1255531-08-8
    Catalog No.: TQP0518
    Purity: 95%
    MF: C9H11BrN2O2
    MW: 259.103
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C(N(N=CC1)C1OCCCC1)=O
  5. 4-phenylpyridazin-3(2H)-one

    CAS No.: 98441-29-3
    Catalog No.: TQP0519
    Purity: 95%
    MF: C10H8N2O
    MW: 172.187
    Storage: 2-8 degree Celsius
    SMILES: C1(=CC=CC=C1)C=1C(NN=CC1)=O
  6. 4-(4-aminophenyl)pyridazin-3(2H)-one

    CAS No.: 98441-35-1
    Catalog No.: TQP0520
    Purity: 95%
    MF: C10H9N3O
    MW: 187.202
    Storage: 2-8 degree Celsius
    SMILES: NC1=CC=C(C=C1)C=1C(NN=CC1)=O
  7. 4-(3-methoxyphenyl)pyridazin-3(2H)-one

    CAS No.: 862855-81-0
    Catalog No.: TQP0521
    Purity: 95%
    MF: C11H10N2O2
    MW: 202.213
    Storage: 2-8 degree Celsius
    SMILES: COC=1C=C(C=CC1)C=1C(NN=CC1)=O
  8. 4-(4-amino-3-methoxyphenyl)pyridazin-3(2H)-one

    CAS No.: 862855-84-3
    Catalog No.: TQP0522
    Purity: 95%
    MF: C11H11N3O2
    MW: 217.228
    Storage: 2-8 degree Celsius
    SMILES: NC1=C(C=C(C=C1)C=1C(NN=CC1)=O)OC
  9. 4-morpholinopyridazin-3(2H)-one

    CAS No.: 21131-05-5
    Catalog No.: TQP0523
    Purity: 95%
    MF: C8H11N3O2
    MW: 181.195
    Storage: 2-8 degree Celsius
    SMILES: O1CCN(CC1)C=1C(NN=CC1)=O
  10. 4-(piperidin-1-yl)pyridazin-3(2H)-one

    CAS No.: 82226-35-5
    Catalog No.: TQP0524
    Purity: 95%
    MF: C9H13N3O
    MW: 179.223
    Storage: 2-8 degree Celsius
    SMILES: N1(CCCCC1)C=1C(NN=CC1)=O
Loading ...Load More ...
Set Ascending Direction

   

Items 21 to 30 of 264 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5