•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyrazolopyrazines

Set Descending Direction

   

Items 1 to 10 of 83 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 2-amino-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one

    CAS No.: 1250444-01-9
    Catalog No.: 197654
    Purity: 95%
    MF: C6H8N4O
    MW: 152.157
    Storage: 2-8 degree Celsius
    SMILES: NC1=NN2C(C(NCC2)=O)=C1
  2. tert-butyl (4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yl)carbamate

    CAS No.: 1780717-11-4
    Catalog No.: 197664
    Purity: 95%
    MF: C11H18N4O2
    MW: 238.291
    Storage: 2-8 degree Celsius
    SMILES: N1=C(C=C2N1CCNC2)NC(OC(C)(C)C)=O
  3. 2-(difluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine

    CAS No.: 1616709-91-1
    Catalog No.: 197663
    Purity: 95%
    MF: C7H9F2N3
    MW: 173.166
    Storage: 2-8 degree Celsius
    SMILES: FC(C1=NN2C(CNCC2)=C1)F
  4. 3-(2-amino-6,7-dihydropyrazolo[1,5-a]pyrazin-5(4H)-yl)propanenitrile

    CAS No.: 1434054-35-9
    Catalog No.: 197662
    Purity: 95%
    MF: C9H13N5
    MW: 191.238
    Storage: 2-8 degree Celsius
    SMILES: NC1=NN2C(CN(CC2)CCC#N)=C1
  5. 5-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-amine

    CAS No.: 1433854-17-1
    Catalog No.: 197661
    Purity: 95%
    MF: C8H11F3N4
    MW: 220.198
    Storage: 2-8 degree Celsius
    SMILES: FC(CN1CC=2N(CC1)N=C(C2)N)(F)F
  6. 5-methyl-2-nitro-6,7-dihydropyrazolo[1,5-a]pyrazin-4(5H)-one

    CAS No.: 1408327-48-9
    Catalog No.: 197660
    Purity: 95%
    MF: C7H8N4O3
    MW: 196.166
    Storage: 2-8 degree Celsius
    SMILES: CN1C(C=2N(CC1)N=C(C2)[N+](=O)[O-])=O
  7. 2-bromo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine

    CAS No.: 1402672-14-3
    Catalog No.: 197659
    Purity: 95%
    MF: C6H8BrN3
    MW: 202.055
    Storage: 2-8 degree Celsius
    SMILES: BrC1=NN2C(CNCC2)=C1
  8. 5-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-amine

    CAS No.: 1346676-02-5
    Catalog No.: 197658
    Purity: 95%
    MF: C8H14N4
    MW: 166.228
    Storage: 2-8 degree Celsius
    SMILES: C(C)N1CC=2N(CC1)N=C(C2)N
  9. 5-cyclopropyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-amine

    CAS No.: 1346673-35-5
    Catalog No.: 197657
    Purity: 95%
    MF: C9H14N4
    MW: 178.239
    Storage: 2-8 degree Celsius
    SMILES: C1(CC1)N1CC=2N(CC1)N=C(C2)N
  10. tert-butyl 2-formyl-6,7-dihydropyrazolo[1,5-a]pyrazine-5(4H)-carboxylate

    CAS No.: 1286754-11-7
    Catalog No.: 197656
    Purity: 95%
    MF: C12H17N3O3
    MW: 251.286
    Storage: 2-8 degree Celsius
    SMILES: C(=O)C1=NN2C(CN(CC2)C(=O)OC(C)(C)C)=C1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 83 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5