•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyrazoles

Set Ascending Direction

   

Items 61 to 70 of 842 total

  1. 5
  2. 6
  3. 7
  4. 8
  5. 9
  1. 3-bromo-1-(2-fluoroethyl)-1H-pyrazole

    CAS No.: 1876711-33-9
    Catalog No.: TQR0693
    Purity: 95%
    MF: C5H6BrFN2
    MW: 193.019
    Storage: 2-8 degree Celsius
    SMILES: BrC1=NN(C=C1)CCF
  2. 3,5-dimethyl-4-(4-(pyrrolidin-2-yl)phenyl)-1H-pyrazole

    CAS No.: 2226195-00-0
    Catalog No.: TQR0735
    Purity: 95%
    MF: C15H19N3
    MW: 241.338
    Storage: 2-8 degree Celsius
    SMILES: CC1=NNC(=C1C1=CC=C(C=C1)C1NCCC1)C
  3. methyl 5-bromo-1,3-dimethyl-1H-pyrazole-4-carboxylate

    CAS No.: 1779928-68-5
    Catalog No.: TQR0747
    Purity: 95%
    MF: C7H9BrN2O2
    MW: 233.065
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(C(=NN1C)C)C(=O)OC
  4. 5-bromo-1,3-dimethyl-1H-pyrazole-4-carboxylic acid

    CAS No.: 1369357-72-1
    Catalog No.: TQR0748
    Purity: 95%
    MF: C6H7BrN2O2
    MW: 219.038
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(C(=NN1C)C)C(=O)O
  5. 7-(5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)-2,5-dimethylimidazo[5,1-f][1,2,4]triazin-4(1H)-one

    CAS No.: 2227024-15-7
    Catalog No.: TQR0750
    Purity: 95%
    MF: C12H13ClN6O
    MW: 292.73
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C(=NN1C)C)C1=NC(=C2C(N=C(NN21)C)=O)C
  6. 7-(5-bromo-1,3-dimethyl-1H-pyrazol-4-yl)-2,5-dimethylimidazo[5,1-f][1,2,4]triazin-4(3H)-one

    CAS No.: 2227012-54-4
    Catalog No.: TQR0751
    Purity: 95%
    MF: C12H13BrN6O
    MW: 337.181
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(C(=NN1C)C)C1=NC(=C2C(NC(=NN21)C)=O)C
  7. 4-(4-(chloromethyl)phenyl)-1-methyl-1H-pyrazole

    CAS No.: 1418201-68-9
    Catalog No.: TQR0771
    Purity: 95%
    MF: C11H11ClN2
    MW: 206.676
    Storage: 2-8 degree Celsius
    SMILES: ClCC1=CC=C(C=C1)C=1C=NN(C1)C
  8. 3-(4-(bromomethyl)phenyl)-1-methyl-1H-pyrazole

    CAS No.: 1820815-38-0
    Catalog No.: TQR0772
    Purity: 95%
    MF: C11H11BrN2
    MW: 251.127
    Storage: 2-8 degree Celsius
    SMILES: BrCC1=CC=C(C=C1)C1=NN(C=C1)C
  9. 4-(4-(chloromethyl)-3-fluorophenyl)-1-methyl-1H-pyrazole

    CAS No.: 1392081-37-6
    Catalog No.: TQR0777
    Purity: 95%
    MF: C11H10ClFN2
    MW: 224.666
    Storage: 2-8 degree Celsius
    SMILES: ClCC1=C(C=C(C=C1)C=1C=NN(C1)C)F
  10. (1R,5S,6r)-6-(1-(4-fluorophenyl)-1H-pyrazol-3-yl)-3-azabicyclo[3.1.0]hexane

    CAS No.: 2075635-91-3
    Catalog No.: TQR0798
    Purity: 95%
    MF: C14H14FN3
    MW: 243.28
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC=C(N2N=C([C@@H]3[C@@]4([H])CNC[C@@]34[H])C=C2)C=C1
Loading ...Load More ...
Set Ascending Direction

   

Items 61 to 70 of 842 total

  1. 5
  2. 6
  3. 7
  4. 8
  5. 9