•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyrazines

Set Descending Direction

   

Items 1 to 10 of 696 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 3-bromo-5-chloropyrazin-2-amine

    CAS No.: 76537-18-3
    Catalog No.: 100100
    Purity: 95%
    MF: C4H3BrClN3
    MW: 208.446
    Storage: 2-8 degree Celsius
    SMILES: NC1=NC=C(Cl)N=C1Br
  2. 3-amino-6-chloropyrazine-2-carbonitrile

    CAS No.: 17231-50-4
    Catalog No.: 100101
    Purity: 95%
    MF: C5H3ClN4
    MW: 154.56
    Storage: 2-8 degree Celsius
    SMILES: NC1=NC=C(Cl)N=C1C#N
  3. 5-chloro-3-(trifluoromethyl)pyrazin-2-amine

    CAS No.: 1364663-32-0
    Catalog No.: 100102
    Purity: 95%
    MF: C5H3ClF3N3
    MW: 197.547
    Storage: 2-8 degree Celsius
    SMILES: NC1=NC=C(Cl)N=C1C(F)(F)F
  4. 3-amino-6-bromopyrazine-2-carbaldehyde

    CAS No.: 1196156-63-4
    Catalog No.: 100103
    Purity: 95%
    MF: C5H4BrN3O
    MW: 202.011
    Storage: 2-8 degree Celsius
    SMILES: NC1=NC=C(Br)N=C1C=O
  5. methyl 3-amino-6-bromopyrazine-2-carboxylate

    CAS No.: 6966-01-4
    Catalog No.: 100104
    Purity: 95%
    MF: C6H6BrN3O2
    MW: 232.037
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)C1=NC(Br)=CN=C1N
  6. 2-chloro-6-methylpyrazine

    CAS No.: 38557-71-0
    Catalog No.: 100105
    Purity: 95%
    MF: C5H5ClN2
    MW: 128.562
    Storage: 2-8 degree Celsius
    SMILES: CC1=CN=CC(Cl)=N1
  7. 6-nitro-3-oxo-3,4-dihydropyrazine-2-carboxamide

    CAS No.: 259793-97-0
    Catalog No.: 100106
    Purity: 95%
    MF: C5H4N4O4
    MW: 184.111
    Storage: 2-8 degree Celsius
  8. 3,6-dichloropyrazine-2-carbonitrile

    CAS No.: 356783-16-9
    Catalog No.: 100107
    Purity: 95%
    MF: C5HCl2N3
    MW: 173.99
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CN=C(Cl)C(=N1)C#N
  9. 4-amino-N-(3-chloropyrazin-2-yl)benzenesulfonamide

    CAS No.: 14423-79-1
    Catalog No.: 100319
    Purity: 95%
    MF: C10H9ClN4O2S
    MW: 284.728
    Storage: 2-8 degree Celsius
    SMILES: NC1=CC=C(C=C1)S(=O)(=O)NC1=NC=CN=C1Cl
  10. N-(3-methoxypyrazin-2-yl)-4-nitrobenzenesulfonamide

    CAS No.: 94625-43-1
    Catalog No.: 100320
    Purity: 95%
    MF: C11H10N4O5S
    MW: 310.291
    Storage: 2-8 degree Celsius
    SMILES: COC1=NC=CN=C1NS(=O)(=O)C1=CC=C(C=C1)[N+]([O-])=O
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 696 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5