•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Protein Tyrosine Kinase

Set Descending Direction

   

Items 1 to 10 of 294 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. Alectinib; CH5424802

    CAS No.: 1256580-46-7
    Catalog No.: 100947
    Purity: 95%
    MF: C30H34N4O2
    MW: 482.628
    Storage: 2-8 degree Celsius
    SMILES: CCC1=C(C=C2C(=C1)C(=O)C1=C(NC3=C1C=CC(=C3)C#N)C2(C)C)N1CCC(CC1)N1CCOCC1
  2. Axitinib

    CAS No.: 319460-85-0
    Catalog No.: 101033
    Purity: 95%
    MF: C22H18N4OS
    MW: 386.48
    Storage: 2-8 degree Celsius
    SMILES: CNC(=O)C1=CC=CC=C1SC1=CC2=C(C=C1)C(\C=C\C1=NC=CC=C1)=NN2
  3. Cediranib; AZD2171

    CAS No.: 288383-20-0
    Catalog No.: 100956
    Purity: 95%
    MF: C25H27FN4O3
    MW: 450.514
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC2=C(OC3=C(F)C4=C(NC(C)=C4)C=C3)N=CN=C2C=C1OCCCN1CCCC1
  4. Crizotinib; PF-02341066

    CAS No.: 877399-52-5
    Catalog No.: 100966
    Purity: 95%
    MF: C21H22Cl2FN5O
    MW: 450.345
    Storage: 2-8 degree Celsius
    SMILES: C[C@@H](OC1=CC(=CN=C1N)C1=CN(N=C1)C1CCNCC1)C1=C(Cl)C=CC(F)=C1Cl
  5. GW441756; GW 441756

    CAS No.: 504433-23-2
    Catalog No.: 100878
    Purity: 95%
    MF: C17H13N3O
    MW: 275.311
    Storage: 2-8 degree Celsius
    SMILES: CN1C=C(\C=C2/C(=O)NC3=CC=CN=C23)C2=C1C=CC=C2
  6. Linifanib; ABT-869

    CAS No.: 796967-16-3
    Catalog No.: 101005
    Purity: 95%
    MF: C21H18FN5O
    MW: 375.407
    Storage: 2-8 degree Celsius
  7. LY2874455

    CAS No.: 1254473-64-7
    Catalog No.: 100944
    Purity: 95%
    MF: C21H19Cl2N5O2
    MW: 444.322
    Storage: 2-8 degree Celsius
    SMILES: C[C@@H](OC1=CC2=C(NN=C2\C=C\C2=CN(CCO)N=C2)C=C1)C1=C(Cl)C=NC=C1Cl
  8. MK-8033; MK 8033

    CAS No.: 1001917-37-8
    Catalog No.: 100853
    Purity: 95%
    MF: C25H21N5O3S
    MW: 471.542
    Storage: 2-8 degree Celsius
    SMILES: CN1C=C(C=N1)C1=CN=C2C=CC3=CC=C(CS(=O)(=O)NCC4=NC=CC=C4)C=C3C(=O)C2=C1
  9. Nintedanib; BIBF 1120; BIBF-1120; Vargatef

    CAS No.: 656247-17-5
    Catalog No.: 100837
    Purity: 95%
    MF: C31H33N5O4
    MW: 539.636
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)C1=CC2=C(C=C1)\C(=C(\NC1=CC=C(C=C1)N(C)C(=O)CN1CCN(C)CC1)C1=CC=CC=C1)C(=O)N2
  10. Pazopanib

    CAS No.: 444731-52-6
    Catalog No.: 101034
    Purity: 95%
    MF: C21H23N7O2S
    MW: 437.529
    Storage: 2-8 degree Celsius
    SMILES: CN(C1=CC2=NN(C)C(C)=C2C=C1)C1=NC(NC2=CC=C(C)C(=C2)S(N)(=O)=O)=NC=C1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 294 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5