•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Protein Tyrosine Kinase

Set Ascending Direction

   

Items 1 to 10 of 106 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. DS-1205b

    CAS No.: 1855860-24-0
    Catalog No.: 193666
    Purity: 95%
    MF: C41H42FN5O7
    MW: 735.813
    Storage: 2-8 degree Celsius
    SMILES: O1[C@H](COCC1)COC1=C(C=C(C=C1)C=1C=C(C(=NC1)N)C1=C(C=C(C=C1)NC(=O)C=1C(C(=CN(C1)CC1CCOCC1)C1=NC=C(C=C1)C)=O)F)OC
  2. Foretinib; GSK1363089

    CAS No.: 849217-64-7
    Catalog No.: 101020
    Purity: 95%
    MF: C34H34F2N4O6
    MW: 632.664
    Storage: 2-8 degree Celsius
    SMILES: COC1=C(OCCCN2CCOCC2)C=C2N=CC=C(OC3=CC=C(C=C3F)N(C(=O)C3(CC3)C(N)=O)C3=CC=C(F)C=C3)C2=C1
  3. PF-04217903

    CAS No.: 956905-27-4
    Catalog No.: 104836
    Purity: 95%
    MF: C19H16N8O
    MW: 372.392
    Storage: 2-8 degree Celsius
    SMILES: OCCN1C=C(C=N1)C1=CN=C2N=NN(CC3=CC=C4N=CC=CC4=C3)C2=N1
  4. GNF-5837

    CAS No.: 1033769-28-6
    Catalog No.: 111901
    Purity: 95%
    MF: C28H21F4N5O2
    MW: 535.501
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC=C(NC(=O)NC2=CC(=CC=C2F)C(F)(F)F)C=C1NC1=CC2=C(C=C1)\C(=C\C1=CC=CN1)C(=O)N2
  5. Imatinib Mesylate; STI571

    CAS No.: 220127-57-1
    Catalog No.: 112393
    Purity: 95%
    MF: C30H35N7O4S
    MW: 589.722
    Storage: 2-8 degree Celsius
    SMILES: CS(O)(=O)=O.CN1CCN(CC2=CC=C(C=C2)C(=O)NC2=CC=C(C)C(NC3=NC=CC(=N3)C3=CC=CN=C3)=C2)CC1
  6. AMG-47a

    CAS No.: 882663-88-9
    Catalog No.: 112416
    Purity: 95%
    MF: C29H28F3N5O2
    MW: 535.57
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC=C(C=C1C1=CC2=CN=C(NCCN3CCOCC3)N=C2C=C1)C(=O)NC1=CC=CC(=C1)C(F)(F)F
  7. (Rac)-SAR131675

    CAS No.: 1092539-44-0
    Catalog No.: 112442
    Purity: 95%
    MF: C18H22N4O4
    MW: 358.398
    Storage: 2-8 degree Celsius
    SMILES: NC=1N(C2=NC(=CC=C2C(C1C(=O)NC)=O)C#CC(COC)(C)O)CC
  8. Regorafenib monohydrate

    CAS No.: 1019206-88-2
    Catalog No.: 135211
    Purity: 95%
    MF: C21H17ClF4N4O4
    MW: 500.836
    Storage: 2-8 degree Celsius
    SMILES: O.CNC(=O)C1=CC(OC2=CC(F)=C(NC(=O)NC3=CC(=C(Cl)C=C3)C(F)(F)F)C=C2)=CC=N1
  9. OSI-420 hydrochloride

    CAS No.: 183320-51-6
    Catalog No.: 151601
    Purity: 95%
    MF: C21H22ClN3O4
    MW: 415.877
    Storage: 2-8 degree Celsius
    SMILES: Cl.COCCOC1=C(OCCO)C=C2C(NC3=CC(=CC=C3)C#C)=NC=NC2=C1
  10. Butein

    CAS No.: 487-52-5
    Catalog No.: 152152
    Purity: 95%
    MF: C15H12O5
    MW: 272.256
    Storage: 2-8 degree Celsius
    SMILES: OC1=CC(O)=C(C=C1)C(=O)\C=C\C1=CC(O)=C(O)C=C1
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 106 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5