•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Proteases

Set Descending Direction

   

Items 61 to 70 of 79 total

  1. 4
  2. 5
  3. 6
  4. 7
  5. 8
  1. Lopinavir; ABT-378

    CAS No.: 192725-17-0
    Catalog No.: 134368
    Purity: 95%
    MF: C37H48N4O5
    MW: 628.814
    Storage: 2-8 degree Celsius
  2. Ixazomib

    CAS No.: 1239908-20-3
    Catalog No.: 139039
    Purity: 95%
    MF: C20H23BCl2N2O9
    MW: 517.127
    Storage: 2-8 degree Celsius
  3. Vardenafil

    CAS No.: 224785-90-4
    Catalog No.: 136203
    Purity: 95%
    MF: C23H32N6O4S
    MW: 488.614
    Storage: 2-8 degree Celsius
  4. Alogliptin

    CAS No.: 850649-61-5
    Catalog No.: 136198
    Purity: 95%
    MF: C18H21N5O2
    MW: 339.399
    Storage: 2-8 degree Celsius
    SMILES: CN1C(=O)C=C(N2CCC[C@@H](N)C2)N(CC2=C(C=CC=C2)C#N)C1=O
  5. Mutant IDH1-IN-2

    CAS No.: 1429176-69-1
    Catalog No.: 135726
    Purity: 95%
    MF: C24H31F2N5O2
    MW: 459.541
    Storage: 2-8 degree Celsius
  6. Mutant IDH1-IN-1

    CAS No.: 1355326-21-4
    Catalog No.: 135725
    Purity: 95%
    MF: C30H31FN4O2
    MW: 498.602
    Storage: 2-8 degree Celsius
  7. Enasidenib

    CAS No.: 1446502-11-9
    Catalog No.: 135727
    Purity: 95%
    MF: C19H17F6N7O
    MW: 473.381
    Storage: 2-8 degree Celsius
  8. Trelagliptin

    CAS No.: 865759-25-7
    Catalog No.: 135205
    Purity: 95%
    MF: C18H20FN5O2
    MW: 357.389
    Storage: 2-8 degree Celsius
  9. VR23

    CAS No.: 1624602-30-7
    Catalog No.: 135064
    Purity: 95%
    MF: C19H16ClN5O6S
    MW: 477.886
    Storage: 2-8 degree Celsius
  10. ONX-0914; PR-957

    CAS No.: 960374-59-8
    Catalog No.: 134422
    Purity: 95%
    MF: C31H40N4O7
    MW: 580.682
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Descending Direction

   

Items 61 to 70 of 79 total

  1. 4
  2. 5
  3. 6
  4. 7
  5. 8