•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Proteases

Set Descending Direction

   

Items 1 to 10 of 79 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. Edaravone

    CAS No.: 89-25-8
    Catalog No.: 141380
    Purity: 95%
    MF: C10H10N2O
    MW: 174.203
    Storage: 2-8 degree Celsius
    SMILES: CC1=NN(C(=O)C1)C1=CC=CC=C1
  2. VX-222; VCH-222; Lomibuvir

    CAS No.: 1026785-59-0
    Catalog No.: 141401
    Purity: 95%
    MF: C25H35NO4S
    MW: 445.625
    Storage: 2-8 degree Celsius
    SMILES: C[C@H]1CC[C@@H](CC1)C(=O)N(C1CC[C@H](O)CC1)C1=C(SC(=C1)C#CC(C)(C)C)C(O)=O
  3. TH-302

    CAS No.: 918633-87-1
    Catalog No.: 141614
    Purity: 95%
    MF: C9H16Br2N5O4P
    MW: 449.04
    Storage: 2-8 degree Celsius
    SMILES: CN1C(COP(=O)(NCCBr)NCCBr)=CN=C1[N+]([O-])=O
  4. Oprozomib; ONX 0912

    CAS No.: 935888-69-0
    Catalog No.: 141848
    Purity: 95%
    MF: C25H32N4O7S
    MW: 532.619
    Storage: 2-8 degree Celsius
    SMILES: COC[C@H](NC(=O)[C@H](COC)NC(=O)C1=CN=C(C)S1)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)[C@@]1(C)CO1
  5. Nafamostat Mesylate

    CAS No.: 82956-11-4
    Catalog No.: 141389
    Purity: 95%
    MF: C21H25N5O8S2
    MW: 539.592
    Storage: 2-8 degree Celsius
    SMILES: CS(O)(=O)=O.CS(O)(=O)=O.NC(=N)NC1=CC=C(C=C1)C(=O)OC1=CC=C2C=C(C=CC2=C1)C(N)=N
  6. Metolazone

    CAS No.: 17560-51-9
    Catalog No.: 141413
    Purity: 95%
    MF: C16H16ClN3O3S
    MW: 365.842
    Storage: 2-8 degree Celsius
    SMILES: CC1NC2=CC(Cl)=C(C=C2C(=O)N1C1=C(C)C=CC=C1)S(N)(=O)=O
  7. Methoxsalen

    CAS No.: 298-81-7
    Catalog No.: 141480
    Purity: 95%
    MF: C12H8O4
    MW: 216.192
    Storage: 2-8 degree Celsius
    SMILES: COC1=C2OC(=O)C=CC2=CC2=C1OC=C2
  8. Marimastat(BB-2516)

    CAS No.: 154039-60-8
    Catalog No.: 141867
    Purity: 95%
    MF: C15H29N3O5
    MW: 331.413
    Storage: 2-8 degree Celsius
    SMILES: CNC(=O)[C@@H](NC(=O)[C@H](CC(C)C)[C@H](O)C(=O)NO)C(C)(C)C
  9. Malotilate

    CAS No.: 59937-28-9
    Catalog No.: 141351
    Purity: 95%
    MF: C12H16O4S2
    MW: 288.39
    Storage: 2-8 degree Celsius
    SMILES: CC(C)OC(=O)C(C(=O)OC(C)C)=C1SC=CS1
  10. Gabexate Mesylate

    CAS No.: 56974-61-9
    Catalog No.: 141509
    Purity: 95%
    MF: C17H27N3O7S
    MW: 417.484
    Storage: 2-8 degree Celsius
    SMILES: CS(O)(=O)=O.CCOC(=O)C1=CC=C(OC(=O)CCCCCNC(N)=N)C=C1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 79 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5