•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Proteases

Set Ascending Direction

   

Items 21 to 30 of 31 total

  1. 1
  2. 2
  3. 3
  4. 4
  1. Doxycycline Hyclate

    CAS No.: 24390-14-5
    Catalog No.: 141736
    Purity: 95%
    MF: C46H58Cl2N4O18
    MW: 1025.886
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].Cl[H].[H]O[H].CCO.[H][C@@]12[C@@H](C)C3=C(C(O)=CC=C3)C(=O)C1=C(O)[C@]1(O)C(=O)C(C(N)=O)=C(O)[C@@H](N(C)C)[C@]1([H])[C@H]2O.[H][C@@]12[C@@H](C)C3=C(C(O)=CC=C3)C(=O)C1=C(O)[C@]1(O)C(=O)C(C(N)=O)=C(O)[C@@H](N(C)C)[C@]1([H])[C@H]2O
  2. Pitavastatin Calcium; NK-104

    CAS No.: 147526-32-7
    Catalog No.: 141453
    Purity: 95%
    MF: C25H23CaFNO4+
    MW: 460.538
    Storage: 2-8 degree Celsius
    SMILES: [Ca++].O[C@H](C[C@H](O)\C=C\C1=C(C2=CC=C(F)C=C2)C2=CC=CC=C2N=C1C1CC1)CC([O-])=O
  3. Alogliptin

    CAS No.: 850649-61-5
    Catalog No.: 136198
    Purity: 95%
    MF: C18H21N5O2
    MW: 339.399
    Storage: 2-8 degree Celsius
    SMILES: CN1C(=O)C=C(N2CCC[C@@H](N)C2)N(CC2=C(C=CC=C2)C#N)C1=O
  4. Enasidenib

    CAS No.: 1446502-11-9
    Catalog No.: 135727
    Purity: 95%
    MF: C19H17F6N7O
    MW: 473.381
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(O)CNC1=NC(NC2=CC(=NC=C2)C(F)(F)F)=NC(=N1)C1=NC(=CC=C1)C(F)(F)F
  5. Mutant IDH1-IN-2

    CAS No.: 1429176-69-1
    Catalog No.: 135726
    Purity: 95%
    MF: C24H31F2N5O2
    MW: 459.541
    Storage: 2-8 degree Celsius
    SMILES: CC(C)[C@H]1COC(=O)N1C1=CC=NC(N[C@@H](C)C2=CC=C(CN3CCC(F)(F)CC3)C=C2)=N1
  6. Mutant IDH1-IN-1

    CAS No.: 1355326-21-4
    Catalog No.: 135725
    Purity: 95%
    MF: C30H31FN4O2
    MW: 498.602
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(C=CC=C1)C(N(C(=O)CN1C=NC2=CC=CC=C12)C1=CC(F)=CC=C1)C(=O)NC1CCCCC1
  7. Vardenafil

    CAS No.: 224785-90-4
    Catalog No.: 136203
    Purity: 95%
    MF: C23H32N6O4S
    MW: 488.614
    Storage: 2-8 degree Celsius
    SMILES: CCCC1=NC(C)=C2N1NC(=NC2=O)C1=C(OCC)C=CC(=C1)S(=O)(=O)N1CCN(CC)CC1
  8. RO4929097

    CAS No.: 847925-91-1
    Catalog No.: 111916
    Purity: 95%
    MF: C22H20F5N3O3
    MW: 469.41
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C(=O)NCC(F)(F)C(F)(F)F)C(=O)N[C@H]1C2=CC=CC=C2C2=CC=CC=C2NC1=O
  9. Gabexate Mesylate

    CAS No.: 56974-61-9
    Catalog No.: 141509
    Purity: 95%
    MF: C17H27N3O7S
    MW: 417.484
    Storage: 2-8 degree Celsius
    SMILES: CS(O)(=O)=O.CCOC(=O)C1=CC=C(OC(=O)CCCCCNC(N)=N)C=C1
  10. ONX-0914; PR-957

    CAS No.: 960374-59-8
    Catalog No.: 134422
    Purity: 95%
    MF: C31H40N4O7
    MW: 580.682
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=C(C[C@H](NC(=O)[C@H](C)NC(=O)CN2CCOCC2)C(=O)N[C@@H](CC2=CC=CC=C2)C(=O)[C@@]2(C)CO2)C=C1
Loading ...Load More ...
Set Ascending Direction

   

Items 21 to 30 of 31 total

  1. 1
  2. 2
  3. 3
  4. 4