•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Proteases

Set Ascending Direction

   

Items 11 to 20 of 31 total

  1. 1
  2. 2
  3. 3
  4. 4
  1. Odanacatib; MK-0822; MK 0822; MK0822

    CAS No.: 603139-19-1
    Catalog No.: 104830
    Purity: 95%
    MF: C25H27F4N3O3S
    MW: 525.568
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(F)C[C@H](N[C@@H](C1=CC=C(C=C1)C1=CC=C(C=C1)S(C)(=O)=O)C(F)(F)F)C(=O)NC1(CC1)C#N
  2. DAPT; GSI-IX

    CAS No.: 208255-80-5
    Catalog No.: 104811
    Purity: 95%
    MF: C23H26F2N2O4
    MW: 432.467
    Storage: 2-8 degree Celsius
    SMILES: C[C@H](NC(=O)CC1=CC(F)=CC(F)=C1)C(=O)N[C@H](C(=O)OC(C)(C)C)C1=CC=CC=C1
  3. Amprenavir

    CAS No.: 161814-49-9
    Catalog No.: 104800
    Purity: 95%
    MF: C25H35N3O6S
    MW: 505.637
    Storage: 2-8 degree Celsius
    SMILES: CC(C)CN(C[C@@H](O)[C@H](CC1=CC=CC=C1)NC(=O)O[C@H]1CCOC1)S(=O)(=O)C1=CC=C(N)C=C1
  4. Atazanavir

    CAS No.: 198904-31-3
    Catalog No.: 104791
    Purity: 95%
    MF: C38H52N6O7
    MW: 704.869
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)N[C@H](C(=O)N[C@@H](CC1=CC=CC=C1)[C@@H](O)CN(CC1=CC=C(C=C1)C1=NC=CC=C1)NC(=O)[C@@H](NC(=O)OC)C(C)(C)C)C(C)(C)C
  5. Aloxistatin; E-64d; E-64D; E 64d

    CAS No.: 88321-09-9
    Catalog No.: 103358
    Purity: 95%
    MF: C17H30N2O5
    MW: 342.436
    Storage: 2-8 degree Celsius
    SMILES: CCOC(=O)[C@H]1O[C@@H]1C(=O)N[C@@H](CC(C)C)C(=O)NCCC(C)C
  6. Bortezomib; Velcade; PS-341

    CAS No.: 179324-69-7
    Catalog No.: 101081
    Purity: 95%
    MF: C19H25BN4O4
    MW: 384.245
    Storage: 2-8 degree Celsius
    SMILES: CC(C)C[C@H](NC(=O)[C@H](CC1=CC=CC=C1)NC(=O)C1=NC=CN=C1)B(O)O
  7. R-7128;Mericitabine

    CAS No.: 940908-79-2
    Catalog No.: 193673
    Purity: 95%
    MF: C18H26FN3O6
    MW: 399.419
    Storage: 2-8 degree Celsius
    SMILES: C(C(C)C)(=O)O[C@@H]1[C@H](O[C@H]([C@]1(C)F)N1C(N=C(C=C1)N)=O)COC(C(C)C)=O
  8. Sivelestat; ONO-5046; Adalimumab

    CAS No.: 127373-66-4
    Catalog No.: 152167
    Purity: 95%
    MF: C20H22N2O7S
    MW: 434.47
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)C(=O)OC1=CC=C(C=C1)S(=O)(=O)NC1=C(C=CC=C1)C(=O)NCC(O)=O
  9. CB-839

    CAS No.: 1439399-58-2
    Catalog No.: 152056
    Purity: 95%
    MF: C26H24F3N7O3S
    MW: 571.585
    Storage: 2-8 degree Celsius
    SMILES: FC(F)(F)OC1=CC(CC(=O)NC2=NN=C(CCCCC3=NN=C(NC(=O)CC4=NC=CC=C4)S3)C=C2)=CC=C1
  10. Alvelestat; AZD9668

    CAS No.: 848141-11-7
    Catalog No.: 141883
    Purity: 95%
    MF: C25H22F3N5O4S
    MW: 545.543
    Storage: 2-8 degree Celsius
    SMILES: CN1N=CC=C1C1=C(C)N(C2=CC(=CC=C2)C(F)(F)F)C(=O)C(=C1)C(=O)NCC1=NC=C(C=C1)S(C)(=O)=O
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 31 total

  1. 1
  2. 2
  3. 3
  4. 4