•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

PROTAC Linkers

Set Descending Direction

   

Items 1 to 10 of 571 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. Lenalidomide; Revlimid; CC-5013

    CAS No.: 191732-72-6
    Catalog No.: 109786
    Purity: 95%
    MF: C13H13N3O3
    MW: 259.265
    Storage: 2-8 degree Celsius
    SMILES: NC1=CC=CC2=C1CN(C1CCC(=O)NC1=O)C2=O
  2. Pomalidomide; CC-4047

    CAS No.: 19171-19-8
    Catalog No.: 109806
    Purity: 95%
    MF: C13H11N3O4
    MW: 273.248
    Storage: 2-8 degree Celsius
    SMILES: NC1=CC=CC2=C1C(=O)N(C1CCC(=O)NC1=O)C2=O
  3. (3S)-3-(4-nitro-1-oxo-1,3-dihydro-2H-isoindol-2-yl)piperidine-2,6-dione

    CAS No.: 827026-45-9
    Catalog No.: 120734
    Purity: 95%
    MF: C13H11N3O5
    MW: 289.247
    Storage: 2-8 degree Celsius
    SMILES: [O-][N+](=O)C1=CC=CC2=C1CN([C@H]1CCC(=O)NC1=O)C2=O
  4. ULM-1(MDK7526; (S,R,S)-AHPC; Protein degrader 1)

    CAS No.: 1448297-52-6
    Catalog No.: 133776
    Purity: 95%
    MF: C22H30N4O3S
    MW: 430.574
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(SC=N1)C1=CC=C(CNC(=O)[C@@H]2C[C@@H](O)CN2C(=O)[C@@H](N)C(C)(C)C)C=C1
  5. E3 ligase Ligand 4

    CAS No.: 835616-60-9
    Catalog No.: 135582
    Purity: 95%
    MF: C13H9FN2O4
    MW: 276.223
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC=CC2=C1C(=O)N(C1CCC(=O)NC1=O)C2=O
  6. Thalidomide 5-fluoride

    CAS No.: 835616-61-0
    Catalog No.: 135588
    Purity: 95%
    MF: C13H9FN2O4
    MW: 276.223
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC2=C(C=C1)C(=O)N(C1CCC(=O)NC1=O)C2=O
  7. (2S,4R)-4-hydroxy-N-(4-(4-methylthiazol-5-yl)benzyl)pyrrolidine-2-carboxamide

    CAS No.: 1448189-45-4
    Catalog No.: 135181
    Purity: 95%
    MF: C16H19N3O2S
    MW: 317.414
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(SC=N1)C1=CC=C(CNC(=O)[C@@H]2C[C@@H](O)CN2)C=C1
  8. 4-chloro-2-(2,6-dioxopiperidin-3-yl)isoindoline-1,3-dione

    CAS No.: 244057-36-1
    Catalog No.: 135583
    Purity: 95%
    MF: C13H9ClN2O4
    MW: 292.678
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=CC2=C1C(=O)N(C1CCC(=O)NC1=O)C2=O
  9. 4-(aminomethyl)-2-(2,6-dioxopiperidin-3-yl)isoindoline-1,3-dione

    CAS No.: 444289-08-1
    Catalog No.: 135584
    Purity: 95%
    MF: C14H13N3O4
    MW: 287.275
    Storage: 2-8 degree Celsius
    SMILES: NCC1=CC=CC2=C1C(=O)N(C1CCC(=O)NC1=O)C2=O
  10. 2-(2,6-dioxopiperidin-3-yl)-4-nitroisoindoline-1,3-dione

    CAS No.: 19171-18-7
    Catalog No.: 135585
    Purity: 95%
    MF: C13H9N3O6
    MW: 303.23
    Storage: 2-8 degree Celsius
    SMILES: [O-][N+](=O)C1=CC=CC2=C1C(=O)N(C1CCC(=O)NC1=O)C2=O
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 571 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5