•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Prostaglandin Receptor

Set Descending Direction

   

Items 1 to 10 of 23 total

  1. 1
  2. 2
  3. 3
  1. E-7046; E7046

    CAS No.: 1369489-71-3
    Catalog No.: 182881
    Purity: 95%
    MF: C22H18F5N3O4
    MW: 483.393
    Storage: 2-8 degree Celsius
    SMILES: C[C@H](NC(=O)C1=C(OC2=CC(=CC=C2)C(F)(F)F)N(C)N=C1C(F)F)C1=CC=C(C=C1)C(O)=O
  2. NTP-42

    CAS No.: 2055599-51-2
    Catalog No.: ZB1624
    Purity: 95%
    MF: C25H23F2N3O5S
    MW: 515.538
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)NC(=O)NS(=O)(=O)C1=C(C=CC(=C1)C#N)OC=1C=C(C=CC1)C1=CC=C(C=C1)OC(F)F
  3. Treprostinil Sodium

    CAS No.: 289480-64-4
    Catalog No.: ZB1582
    Purity: 95%
    MF: C23H33NaO5
    MW: 412.502
    Storage: 2-8 degree Celsius
    SMILES: O[C@@H]1C[C@H]2[C@H](CC3=CC=CC(=C3C2)OCC(=O)[O-])[C@H]1CC[C@H](CCCCC)O.[Na+]
  4. Pizuglanstat

    CAS No.: 1244967-98-3
    Catalog No.: WLZ0336
    Purity: 95%
    MF: C27H36N6O4
    MW: 508.623
    Storage: 2-8 degree Celsius
    SMILES: CN1C(=CC=C1)C(=O)N1CCN(CC1)C(=O)NC1=CC=C(C=C1)N1CCC(CC1)C(=O)N1CCOCC1
  5. ONO-8130

    CAS No.: 459841-96-4
    Catalog No.: 194637
    Purity: 95%
    MF: C25H28N2O5S2
    MW: 500.642
    Storage: 2-8 degree Celsius
    SMILES: O=C(O)C1=CC=C(COC2=CC3=C(CCC3)C=C2N(CC(C)C)S(=O)(C4=NC(C)=CS4)=O)C=C1
  6. BAY-1316957

    CAS No.: 1613264-40-6
    Catalog No.: 193696
    Purity: 95%
    MF: C27H27N3O3
    MW: 441.531
    Storage: 2-8 degree Celsius
    SMILES: C(C)N1C2=CC=C(C=C2C=2C=C(C=CC12)C1=NC2=C(N1CCOC)C=CC(=C2C)C(=O)O)C
  7. Bimatoprost

    CAS No.: 155206-00-1
    Catalog No.: 186485
    Purity: 95%
    MF: C25H37NO4
    MW: 415.574
    Storage: 2-8 degree Celsius
    SMILES: O[C@H]1[C@@H]([C@H]([C@H](C1)O)C\C=C/CCCC(=O)NCC)\C=C\[C@H](CCC1=CC=CC=C1)O
  8. MK7246

    CAS No.: 1218918-62-7
    Catalog No.: 186484
    Purity: 95%
    MF: C21H21FN2O4S
    MW: 416.474
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC=C(C=C1)S(=O)(=O)N(C)[C@@H]1CCC=2N(C3=CC=CC=C3C2CC(=O)O)C1
  9. CP 544326

    CAS No.: 752187-80-7
    Catalog No.: 169476
    Purity: 95%
    MF: C24H22N4O5S
    MW: 478.53
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)COC1=CC(CN(CC2=CC=C(C=C2)N2C=CC=N2)S(=O)(=O)C2=CC=CN=C2)=CC=C1
  10. GW627368X

    CAS No.: 439288-66-1
    Catalog No.: 157261
    Purity: 95%
    MF: C30H28N2O6S
    MW: 544.629
    Storage: 2-8 degree Celsius
    SMILES: CCOC1=C2C=CC=CC2=C(OCC)C2=C1CN(C2=O)C1=CC=C(CC(=O)NS(=O)(=O)C2=CC=CC=C2)C=C1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 23 total

  1. 1
  2. 2
  3. 3