•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

PPAR

Set Descending Direction

   

Items 1 to 10 of 20 total

  1. 1
  2. 2
  1. Bezafibrate

    CAS No.: 41859-67-0
    Catalog No.: 141733
    Purity: 95%
    MF: C19H20ClNO4
    MW: 361.825
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(OC1=CC=C(CCNC(=O)C2=CC=C(Cl)C=C2)C=C1)C(O)=O
  2. MA-0204

    CAS No.: 2095128-17-7
    Catalog No.: 186533
    Purity: 95%
    MF: C25H27F3N2O4
    MW: 476.495
    Storage: 2-8 degree Celsius
    SMILES: C[C@@H](CC(=O)O)CCCOC1=C(C=CC=C1)CN1C(=NC=C1C)C1=CC=C(C=C1)OC(F)(F)F
  3. MBX-8025

    CAS No.: 851528-79-5
    Catalog No.: 186465
    Purity: 95%
    MF: C21H23F3O5S
    MW: 444.471
    Storage: 2-8 degree Celsius
    SMILES: C(C)O[C@@H](CSC1=CC(=C(OCC(=O)O)C=C1)C)COC1=CC=C(C=C1)C(F)(F)F
  4. BMS-687453

    CAS No.: 1000998-59-3
    Catalog No.: 157310
    Purity: 95%
    MF: C22H21ClN2O6
    MW: 444.871
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)N(CC(O)=O)CC1=CC(OCC2=C(C)OC(=N2)C2=CC=C(Cl)C=C2)=CC=C1
  5. VCE-004.8

    CAS No.: 1818428-24-8
    Catalog No.: ZB1584
    Purity: 95%
    MF: C28H35NO3
    MW: 433.58
    Storage: 2-8 degree Celsius
    SMILES: O=C(C(NCC1=CC=CC=C1)=C2CCCCC)C([C@@H]3C=C(C)CC[C@H]3C(C)=C)=C(O)C2=O
  6. Pemafibrate; K-877

    CAS No.: 848259-27-8
    Catalog No.: 183278
    Purity: 95%
    MF: C28H30N2O6
    MW: 490.556
    Storage: 2-8 degree Celsius
    SMILES: CC[C@@H](OC1=CC(CN(CCCOC2=CC=C(OC)C=C2)C2=NC3=CC=CC=C3O2)=CC=C1)C(O)=O
  7. Rosiglitazone HCl

    CAS No.: 302543-62-0
    Catalog No.: 141504
    Purity: 95%
    MF: C18H20ClN3O3S
    MW: 393.896
    Storage: 2-8 degree Celsius
    SMILES: Cl.CN(CCOC1=CC=C(CC2SC(=O)NC2=O)C=C1)C1=NC=CC=C1
  8. Gemfibrozil

    CAS No.: 25812-30-0
    Catalog No.: 141444
    Purity: 95%
    MF: C15H22O3
    MW: 250.338
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC(OCCCC(C)(C)C(O)=O)=C(C)C=C1
  9. Fenofibric acid

    CAS No.: 42017-89-0
    Catalog No.: 141806
    Purity: 95%
    MF: C17H15ClO4
    MW: 318.756
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(OC1=CC=C(C=C1)C(=O)C1=CC=C(Cl)C=C1)C(O)=O
  10. Clofibric acid

    CAS No.: 882-09-7
    Catalog No.: 141752
    Purity: 95%
    MF: C10H11ClO3
    MW: 214.648
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(OC1=CC=C(Cl)C=C1)C(O)=O
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 20 total

  1. 1
  2. 2