•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Potassium Channel

Set Descending Direction

   

Items 1 to 10 of 40 total

  1. 1
  2. 2
  3. 3
  4. 4
  1. ML418

    CAS No.: 1928763-08-9
    Catalog No.: WLZ0116
    Purity: 95%
    MF: C19H24ClN3O3
    MW: 377.872
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C2C=CC=NC2=C(C(=C1)CN1CCC(CC1)NC(OC(C)C)=O)O
  2. Retigabine Dihydrochloride

    CAS No.: 150812-13-8
    Catalog No.: 154262
    Purity: 95%
    MF: C16H20Cl2FN3O2
    MW: 376.259
    Storage: 2-8 degree Celsius
    SMILES: Cl.Cl.CCOC(=O)NC1=C(N)C=C(NCC2=CC=C(F)C=C2)C=C1
  3. Mitiglinide Calcium

    CAS No.: 207844-01-7
    Catalog No.: 154552
    Purity: 95%
    MF: C38H52CaN2O8
    MW: 704.918
    Storage: 2-8 degree Celsius
    SMILES: [Ca++].[H]O[H].[H]O[H].[H][C@@]12CN(C[C@]1([H])CCCC2)C(=O)C[C@H](CC1=CC=CC=C1)C([O-])=O.[H][C@@]12CN(C[C@]1([H])CCCC2)C(=O)C[C@H](CC1=CC=CC=C1)C([O-])=O
  4. NS6180

    CAS No.: 353262-04-1
    Catalog No.: 157265
    Purity: 95%
    MF: C16H12F3NOS
    MW: 323.339
    Storage: 2-8 degree Celsius
    SMILES: FC(F)(F)C1=CC=CC(CN2C(=O)CSC3=C2C=CC=C3)=C1
  5. ML-365

    CAS No.: 947914-18-3
    Catalog No.: 169446
    Purity: 95%
    MF: C22H20N2O3
    MW: 360.413
    Storage: 2-8 degree Celsius
    SMILES: COC1=C(C=CC=C1)C(=O)NC1=CC(NC(=O)C2=CC(C)=CC=C2)=CC=C1
  6. ML 277

    CAS No.: 1401242-74-7
    Catalog No.: 169589
    Purity: 95%
    MF: C23H25N3O4S2
    MW: 471.604
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=C(C=C1)C1=CSC(NC(=O)[C@H]2CCCCN2S(=O)(=O)C2=CC=C(C)C=C2)=N1
  7. Doxapram

    CAS No.: 309-29-5
    Catalog No.: 171851
    Purity: 95%
    MF: C24H30N2O2
    MW: 378.516
    Storage: 2-8 degree Celsius
    SMILES: CCN1CC(CCN2CCOCC2)C(C1=O)(C1=CC=CC=C1)C1=CC=CC=C1
  8. RY785; Kv2-IN-A1

    CAS No.: 689297-68-5
    Catalog No.: 194623
    Purity: 95%
    MF: C20H17ClN4OS
    MW: 396.903
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=C(C=CC1)C(CC(=O)NC1=CC2=C(NC(=N2)C=2N=CSC2)C=C1)C
  9. ICA-105574

    CAS No.: 316146-57-3
    Catalog No.: 194701
    Purity: 95%
    MF: C19H14N2O4
    MW: 334.331
    Storage: 2-8 degree Celsius
    SMILES: [N+](=O)([O-])C=1C=C(C(=O)NC2=CC=C(C=C2)OC2=CC=CC=C2)C=CC1
  10. ASP 2905

    CAS No.: 792184-90-8
    Catalog No.: 194760
    Purity: 95%
    MF: C20H17FN8
    MW: 388.41
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC=C(C=C1)NC1=NC(=NC(=N1)NC1=CC=CC=C1)NCC1=NC=CC=N1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 40 total

  1. 1
  2. 2
  3. 3
  4. 4