•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Piperidines

Set Ascending Direction

   

Items 51 to 60 of 4133 total

  1. 4
  2. 5
  3. 6
  4. 7
  5. 8
  1. tert-butyl 2-benzyl-4-oxopiperidine-1-carboxylate

    CAS No.: 193480-28-3
    Catalog No.: 102750
    Purity: 95%
    MF: C17H23NO3
    MW: 289.375
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)N1CCC(=O)CC1CC1=CC=CC=C1
  2. tert-butyl 4-oxo-2-phenylpiperidine-1-carboxylate

    CAS No.: 849928-30-9
    Catalog No.: 102751
    Purity: 95%
    MF: C16H21NO3
    MW: 275.348
    Storage: 2-8 degree Celsius
  3. 2-(1-(tert-butoxycarbonyl)piperidin-4-yl)acetic acid

    CAS No.: 157688-46-5
    Catalog No.: 102753
    Purity: 95%
    MF: C12H21NO4
    MW: 243.303
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)N1CCC(CC(O)=O)CC1
  4. tert-butyl 4-(3-hydroxypropyl)piperidine-1-carboxylate

    CAS No.: 156185-63-6
    Catalog No.: 102766
    Purity: 95%
    MF: C13H25NO3
    MW: 243.347
    Storage: 2-8 degree Celsius
  5. tert-butyl 2-methyl-4-oxopiperidine-1-carboxylate

    CAS No.: 190906-92-4
    Catalog No.: 102781
    Purity: 95%
    MF: C11H19NO3
    MW: 213.277
    Storage: 2-8 degree Celsius
  6. tert-butyl 3-bromo-4-oxopiperidine-1-carboxylate

    CAS No.: 188869-05-8
    Catalog No.: 102826
    Purity: 95%
    MF: C10H16BrNO3
    MW: 278.146
    Storage: 2-8 degree Celsius
  7. 4-(methoxymethyl)piperidine hydrochloride

    CAS No.: 916317-00-5
    Catalog No.: 102854
    Purity: 95%
    MF: C7H16ClNO
    MW: 165.664
    Storage: 2-8 degree Celsius
  8. piperidine-1-sulfonamide

    CAS No.: 4108-90-1
    Catalog No.: 102887
    Purity: 95%
    MF: C5H12N2O2S
    MW: 164.23
    Storage: 2-8 degree Celsius
  9. methyl 4-oxopiperidine-3-carboxylate

    CAS No.: 108554-34-3
    Catalog No.: 102891
    Purity: 95%
    MF: C7H11NO3
    MW: 157.169
    Storage: 2-8 degree Celsius
  10. piperidin-4-yl(pyrrolidin-1-yl)methanone

    CAS No.: 35090-95-0
    Catalog No.: 102892
    Purity: 95%
    MF: C10H18N2O
    MW: 182.267
    Storage: 2-8 degree Celsius
    SMILES: O=C(C1CCNCC1)N1CCCC1
Loading ...Load More ...
Set Ascending Direction

   

Items 51 to 60 of 4133 total

  1. 4
  2. 5
  3. 6
  4. 7
  5. 8