•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Piperazines

Set Descending Direction

   

Items 1 to 10 of 3396 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 1-(3-methoxy-4-nitrophenyl)-4-methylpiperazine

    CAS No.: 761440-26-0
    Catalog No.: 100158
    Purity: 95%
    MF: C12H17N3O3
    MW: 251.286
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC(=CC=C1[N+]([O-])=O)N1CCN(C)CC1
  2. 2-methoxy-4-(4-methylpiperazin-1-yl)aniline

    CAS No.: 122833-04-9
    Catalog No.: 100159
    Purity: 95%
    MF: C12H19N3O
    MW: 221.304
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC(=CC=C1N)N1CCN(C)CC1
  3. (R)-methyl 4-(3-methylpiperazin-1-yl)benzoate

    CAS No.: 1201670-92-9
    Catalog No.: 100160
    Purity: 95%
    MF: C13H18N2O2
    MW: 234.299
    Storage: 2-8 degree Celsius
  4. (R)-methyl 4-(3,4-dimethylpiperazin-1-yl)benzoate

    CAS No.: 1201670-91-8
    Catalog No.: 100161
    Purity: 95%
    MF: C14H20N2O2
    MW: 248.326
    Storage: 2-8 degree Celsius
  5. 5,5-dimethyl-2-(piperazin-1-yl)-4,5-dihydrothiazole

    CAS No.: 303798-21-2
    Catalog No.: 100291
    Purity: 95%
    MF: C9H17N3S
    MW: 199.323
    Storage: 2-8 degree Celsius
  6. 6-ethyl-4-(piperazin-1-yl)thieno[2,3-d]pyrimidine

    CAS No.: 769917-28-4
    Catalog No.: 100297
    Purity: 95%
    MF: C12H16N4S
    MW: 248.355
    Storage: 2-8 degree Celsius
  7. 6-bromo-4-(piperazin-1-yl)thieno[2,3-d]pyrimidine

    CAS No.: 1395492-72-4
    Catalog No.: 100302
    Purity: 95%
    MF: C10H11BrN4S
    MW: 299.197
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC2=C(N=CN=C2S1)N1CCNCC1
  8. tert-butyl 4-(4-(5-chloro-2-hydroxyphenyl)pyrimidin-2-yl)piperazine-1-carboxylate

    CAS No.: 1235407-36-9
    Catalog No.: 100681
    Purity: 95%
    MF: C19H23ClN4O3
    MW: 390.871
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)N1CCN(CC1)C1=NC=CC(=N1)C1=CC(Cl)=CC=C1O
  9. N-methyl-2-(4-methylpiperazin-1-yl)-N-(4-nitrophenyl)acetamide

    CAS No.: 1139453-98-7
    Catalog No.: 101044
    Purity: 95%
    MF: C14H20N4O3
    MW: 292.339
    Storage: 2-8 degree Celsius
  10. N-(4-aminophenyl)-N-methyl-2-(4-methylpiperazin-1-yl)acetamide

    CAS No.: 262368-30-9
    Catalog No.: 101045
    Purity: 95%
    MF: C14H22N4O
    MW: 262.357
    Storage: 2-8 degree Celsius
    SMILES: CN(C(=O)CN1CCN(C)CC1)C1=CC=C(N)C=C1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 3396 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5