•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

PI3K/Akt/mTOR

Set Ascending Direction

   

Items 61 to 70 of 176 total

  1. 5
  2. 6
  3. 7
  4. 8
  5. 9
  1. HS-173

    CAS No.: 1276110-06-5
    Catalog No.: 111931
    Purity: 95%
    MF: C21H18N4O4S
    MW: 422.466
    Storage: 2-8 degree Celsius
  2. PHT-427

    CAS No.: 1191951-57-1
    Catalog No.: 111930
    Purity: 95%
    MF: C20H31N3O2S2
    MW: 409.621
    Storage: 2-8 degree Celsius
  3. PIK-93

    CAS No.: 593960-11-3
    Catalog No.: 111928
    Purity: 95%
    MF: C14H16ClN3O4S2
    MW: 389.886
    Storage: 2-8 degree Celsius
    SMILES: CC(=O)NC1=NC(C)=C(S1)C1=CC=C(Cl)C(=C1)S(=O)(=O)NCCO
  4. PlK-15

    CAS No.: 372196-77-5
    Catalog No.: 111895
    Purity: 95%
    MF: C16H15BrClN5O4S
    MW: 488.751
    Storage: 2-8 degree Celsius
  5. TGX-221

    CAS No.: 663619-89-4
    Catalog No.: 111888
    Purity: 95%
    MF: C21H24N4O2
    MW: 364.449
    Storage: 2-8 degree Celsius
  6. WYE-125132; WYE-132

    CAS No.: 1144068-46-1
    Catalog No.: 111906
    Purity: 95%
    MF: C27H33N7O4
    MW: 519.606
    Storage: 2-8 degree Celsius
    SMILES: CNC(=O)NC1=CC=C(C=C1)C1=NC(N2CC3CCC(C2)O3)=C2C=NN(C3CCC4(CC3)OCCO4)C2=N1
  7. AS-252424

    CAS No.: 900515-16-4
    Catalog No.: 112427
    Purity: 95%
    MF: C14H8FNO4S
    MW: 305.286
    Storage: 2-8 degree Celsius
  8. GNE-477

    CAS No.: 1032754-81-6
    Catalog No.: 112432
    Purity: 95%
    MF: C21H28N8O3S2
    MW: 504.642
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(CN2CCN(CC2)S(C)(=O)=O)SC2=C(N=C(N=C12)C1=CN=C(N)N=C1)N1CCOCC1
  9. PIK-294

    CAS No.: 900185-02-6
    Catalog No.: 112430
    Purity: 95%
    MF: C28H23N7O2
    MW: 489.539
    Storage: 2-8 degree Celsius
  10. PIK-75

    CAS No.: 372196-67-3
    Catalog No.: 112428
    Purity: 95%
    MF: C16H14BrN5O4S
    MW: 452.29
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Ascending Direction

   

Items 61 to 70 of 176 total

  1. 5
  2. 6
  3. 7
  4. 8
  5. 9