•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

PI3K/Akt/mTOR

Set Descending Direction

   

Items 41 to 50 of 176 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7
  1. VS-5584

    CAS No.: 1246560-33-7
    Catalog No.: 106217
    Purity: 95%
    MF: C17H22N8O
    MW: 354.418
    Storage: 2-8 degree Celsius
    SMILES: CC(C)N1C(C)=NC2=C(N=C(N=C12)N1CCOCC1)C1=CN=C(N)N=C1
  2. PKI-402

    CAS No.: 1173204-81-3
    Catalog No.: 108445
    Purity: 95%
    MF: C29H34N10O3
    MW: 570.658
    Storage: 2-8 degree Celsius
  3. AZD5363

    CAS No.: 1143532-39-1
    Catalog No.: 109728
    Purity: 95%
    MF: C21H25ClN6O2
    MW: 428.924
    Storage: 2-8 degree Celsius
    SMILES: NC1(CCN(CC1)C1=C2C=CNC2=NC=N1)C(=O)N[C@@H](CCO)C1=CC=C(Cl)C=C1
  4. BI-D1870

    CAS No.: 501437-28-1
    Catalog No.: 109735
    Purity: 95%
    MF: C19H23F2N5O2
    MW: 391.422
    Storage: 2-8 degree Celsius
    SMILES: CC(C)CCN1C(C)C(=O)N(C)C2=CN=C(NC3=CC(F)=C(O)C(F)=C3)N=C12
  5. GDC-0349

    CAS No.: 1207360-89-1
    Catalog No.: 109849
    Purity: 95%
    MF: C24H32N6O3
    MW: 452.559
    Storage: 2-8 degree Celsius
  6. H 89 2HCl

    CAS No.: 130964-39-5
    Catalog No.: 109770
    Purity: 95%
    MF: C20H22BrCl2N3O2S
    MW: 519.292
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].Cl[H].BrC1=CC=C(\C=C\CNCCNS(=O)(=O)C2=CC=CC3=C2C=CN=C3)C=C1
  7. INK 128; MLN0128

    CAS No.: 1224844-38-5
    Catalog No.: 109776
    Purity: 95%
    MF: C15H15N7O
    MW: 309.333
    Storage: 2-8 degree Celsius
    SMILES: CC(C)N1N=C(C2=C1N=CN=C2N)C1=CC=C2OC(N)=NC2=C1
  8. KU-0063794

    CAS No.: 938440-64-3
    Catalog No.: 109782
    Purity: 95%
    MF: C25H31N5O4
    MW: 465.554
    Storage: 2-8 degree Celsius
  9. OSI-027

    CAS No.: 936890-98-1
    Catalog No.: 109796
    Purity: 95%
    MF: C21H22N6O3
    MW: 406.446
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=CC2=C1NC(=C2)C1=C2N(N=CN=C2N)C(=N1)[C@H]1CC[C@@H](CC1)C(O)=O
  10. Temsirolimus; CCI-779; NSC 683864

    CAS No.: 162635-04-3
    Catalog No.: 109825
    Purity: 95%
    MF: C56H87NO16
    MW: 1030.303
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Descending Direction

   

Items 41 to 50 of 176 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7