•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

PI3K/Akt/mTOR

Set Ascending Direction

   

Items 31 to 40 of 57 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6
  1. CHIR-99021; CT99021

    CAS No.: 252917-06-9
    Catalog No.: 101255
    Purity: 95%
    MF: C22H18Cl2N8
    MW: 465.348
    Storage: 2-8 degree Celsius
    SMILES: CC1=CNC(=N1)C1=CN=C(NCCNC2=CC=C(C=N2)C#N)N=C1C1=CC=C(Cl)C=C1Cl
  2. AR-A014418

    CAS No.: 487021-52-3
    Catalog No.: 111959
    Purity: 95%
    MF: C12H12N4O4S
    MW: 308.319
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=C(CNC(=O)NC2=NC=C(S2)[N+]([O-])=O)C=C1
  3. CHIR-98014

    CAS No.: 252935-94-7
    Catalog No.: 141613
    Purity: 95%
    MF: C20H17Cl2N9O2
    MW: 486.323
    Storage: 2-8 degree Celsius
    SMILES: NC1=C(C=CC(NCCNC2=NC(=C(C=N2)N2C=CN=C2)C2=C(Cl)C=C(Cl)C=C2)=N1)[N+]([O-])=O
  4. SC79

    CAS No.: 305834-79-1
    Catalog No.: 152104
    Purity: 95%
    MF: C17H17ClN2O5
    MW: 364.785
    Storage: 2-8 degree Celsius
    SMILES: CCOC(=O)C(C#N)C1C2=CC(Cl)=CC=C2OC(N)=C1C(=O)OCC
  5. ETC-1002

    CAS No.: 738606-46-7
    Catalog No.: 157306
    Purity: 95%
    MF: C19H36O5
    MW: 344.492
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(CCCCCC(O)CCCCCC(C)(C)C(O)=O)C(O)=O
  6. BGT-226

    CAS No.: 1245537-68-1
    Catalog No.: 104926
    Purity: 95%
    MF: C32H29F3N6O6
    MW: 650.614
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)\C=C/C(O)=O.COC1=CC=C(C=N1)C1=CC=C2N=CC3=C(N(C(=O)N3C)C3=CC=C(N4CCNCC4)C(=C3)C(F)(F)F)C2=C1
  7. BGT-226 Free base

    CAS No.: 915020-55-2
    Catalog No.: 140472
    Purity: 95%
    MF: C28H25F3N6O2
    MW: 534.542
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=C(C=N1)C1=CC=C2N=CC3=C(N(C(=O)N3C)C3=CC(=C(C=C3)N3CCNCC3)C(F)(F)F)C2=C1
  8. ARQ-092

    CAS No.: 1313881-70-7
    Catalog No.: 186224
    Purity: 95%
    MF: C27H24N6
    MW: 432.531
    Storage: 2-8 degree Celsius
    SMILES: NC1(CCC1)C1=CC=C(C=C1)N1C(=NC=2C1=NC(=CC2)C2=CC=CC=C2)C=2C(=NC=CC2)N
  9. PF-04979064

    CAS No.: 1220699-06-8
    Catalog No.: 186429
    Purity: 95%
    MF: C24H26N6O3
    MW: 446.511
    Storage: 2-8 degree Celsius
    SMILES: O[C@H](C(=O)N1CCC(CC1)N1C(N(C=2C=NC=3C=CC(=NC3C21)C=2C=NC(=CC2)C)C)=O)C
  10. Perifosine; KRX-0401

    CAS No.: 157716-52-4
    Catalog No.: 101024
    Purity: 95%
    MF: C25H52NO4P
    MW: 461.668
    Storage: 2-8 degree Celsius
    SMILES: CCCCCCCCCCCCCCCCCCOP([O-])(=O)OC1CC[N+](C)(C)CC1
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 40 of 57 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6