•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

PI3K/Akt/mTOR

Set Descending Direction

   

Items 1 to 10 of 176 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. Buparlisib; BKM120; NVP-BKM120

    CAS No.: 944396-07-0
    Catalog No.: 100821
    Purity: 95%
    MF: C18H21F3N6O2
    MW: 410.4
    Storage: 2-8 degree Celsius
  2. CH5132799; CH 5132799

    CAS No.: 1007207-67-1
    Catalog No.: 100843
    Purity: 95%
    MF: C15H19N7O3S
    MW: 377.43
    Storage: 2-8 degree Celsius
    SMILES: CS(=O)(=O)N1CCC2=C(N=C(N=C12)N1CCOCC1)C1=CN=C(N)N=C1
  3. Dorsomorphin

    CAS No.: 866405-64-3
    Catalog No.: 100860
    Purity: 95%
    MF: C24H25N5O
    MW: 399.498
    Storage: 2-8 degree Celsius
    SMILES: C(CN1CCCCC1)OC1=CC=C(C=C1)C1=CN2N=CC(=C2N=C1)C1=CC=NC=C1
  4. Perifosine; KRX-0401

    CAS No.: 157716-52-4
    Catalog No.: 101024
    Purity: 95%
    MF: C25H52NO4P
    MW: 461.668
    Storage: 2-8 degree Celsius
    SMILES: CCCCCCCCCCCCCCCCCCOP([O-])(=O)OC1CC[N+](C)(C)CC1
  5. SB415286

    CAS No.: 264218-23-7
    Catalog No.: 101147
    Purity: 95%
    MF: C16H10ClN3O5
    MW: 359.725
    Storage: 2-8 degree Celsius
    SMILES: OC1=CC=C(NC2=C(C(=O)NC2=O)C2=CC=CC=C2[N+]([O-])=O)C=C1Cl
  6. PF-04691502; PF 04691502

    CAS No.: 1013101-36-4
    Catalog No.: 101158
    Purity: 95%
    MF: C22H27N5O4
    MW: 425.489
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=C(C=N1)C1=CC2=C(C)N=C(N)N=C2N([C@H]2CC[C@@H](CC2)OCCO)C1=O
  7. CHIR-99021; CT99021

    CAS No.: 252917-06-9
    Catalog No.: 101255
    Purity: 95%
    MF: C22H18Cl2N8
    MW: 465.348
    Storage: 2-8 degree Celsius
  8. Torkinib; PP242

    CAS No.: 1092351-67-1
    Catalog No.: 101187
    Purity: 95%
    MF: C16H16N6O
    MW: 308.345
    Storage: 2-8 degree Celsius
    SMILES: CC(C)N1N=C(C2=CC3=C(N2)C=CC(O)=C3)C2=C(N)N=CN=C12
  9. AT7867; AT-7867

    CAS No.: 857531-00-1
    Catalog No.: 102609
    Purity: 95%
    MF: C20H20ClN3
    MW: 337.854
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=C(C=C1)C1(CCNCC1)C1=CC=C(C=C1)C1=CNN=C1
  10. Vistusertib; AZD2014

    CAS No.: 1009298-59-2
    Catalog No.: 102702
    Purity: 95%
    MF: C25H30N6O3
    MW: 462.554
    Storage: 2-8 degree Celsius
    SMILES: CNC(=O)C1=CC=CC(=C1)C1=CC=C2C(N=C(N=C2N2CCOC[C@@H]2C)N2CCOC[C@@H]2C)=N1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 176 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5