•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Phthalazines

Set Descending Direction

   

Items 1 to 10 of 90 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 6-Nitrophthalazine

    CAS No.: 120493-12-1
    Catalog No.: 195096
    Purity: 95%
    MF: C8H5N3O2
    MW: 175.147
    Storage: 2-8 degree Celsius
    SMILES: [N+](=O)([O-])C=1C=C2C=NN=CC2=CC1
  2. 4-cyclopropylphthalazin-1(2H)-one

    CAS No.: 1309195-43-4
    Catalog No.: TQP1584
    Purity: 95%
    MF: C11H10N2O
    MW: 186.214
    Storage: 2-8 degree Celsius
    SMILES: C1(CC1)C1=NNC(C2=CC=CC=C12)=O
  3. 4-(4-isopropylphenyl)phthalazin-1(2H)-one

    CAS No.: 102990-38-5
    Catalog No.: TQP1583
    Purity: 95%
    MF: C17H16N2O
    MW: 264.328
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)C1=CC=C(C=C1)C1=NNC(C2=CC=CC=C12)=O
  4. 4-(pyridin-2-ylmethyl)phthalazin-1(2H)-one

    CAS No.: 107559-06-8
    Catalog No.: TQP1582
    Purity: 95%
    MF: C14H11N3O
    MW: 237.262
    Storage: 2-8 degree Celsius
    SMILES: N1=C(C=CC=C1)CC1=NNC(C2=CC=CC=C12)=O
  5. 4-ethylphthalazin-1(2H)-one

    CAS No.: 54145-30-1
    Catalog No.: TQP1581
    Purity: 95%
    MF: C10H10N2O
    MW: 174.203
    Storage: 2-8 degree Celsius
    SMILES: C(C)C1=NNC(C2=CC=CC=C12)=O
  6. 4-(4-hydroxy-3,5-dimethylphenyl)phthalazin-1(2H)-one

    CAS No.: 85628-36-0
    Catalog No.: TQP1580
    Purity: 95%
    MF: C16H14N2O2
    MW: 266.3
    Storage: 2-8 degree Celsius
    SMILES: OC1=C(C=C(C=C1C)C1=NNC(C2=CC=CC=C12)=O)C
  7. 4-mesitylphthalazin-1(2H)-one

    CAS No.: 209416-34-2
    Catalog No.: TQP1579
    Purity: 95%
    MF: C17H16N2O
    MW: 264.328
    Storage: 2-8 degree Celsius
    SMILES: C1(=C(C(=CC(=C1)C)C)C1=NNC(C2=CC=CC=C12)=O)C
  8. 4-(3,4-dimethylphenyl)phthalazin-1(2H)-one

    CAS No.: 93517-74-9
    Catalog No.: TQP1578
    Purity: 95%
    MF: C16H14N2O
    MW: 250.301
    Storage: 2-8 degree Celsius
    SMILES: CC=1C=C(C=CC1C)C1=NNC(C2=CC=CC=C12)=O
  9. 4-(3-(1,4-diazepane-1-carbonyl)-4-fluorobenzyl)phthalazin-1(2H)-one

    CAS No.: 763111-49-5
    Catalog No.: TQP1577
    Purity: 95%
    MF: C21H21FN4O2
    MW: 380.423
    Storage: 2-8 degree Celsius
    SMILES: N1(CCNCCC1)C(=O)C=1C=C(CC2=NNC(C3=CC=CC=C23)=O)C=CC1F
  10. 4-benzylphthalazin-1(2H)-one

    CAS No.: 32003-14-8
    Catalog No.: TQP1576
    Purity: 95%
    MF: C15H12N2O
    MW: 236.274
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)C1=NNC(C2=CC=CC=C12)=O
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 90 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5