•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Phthalazines

Set Ascending Direction

   

Items 11 to 20 of 40 total

  1. 1
  2. 2
  3. 3
  4. 4
  1. 1,8-dichlorophthalazine

    CAS No.: 1263378-72-8
    Catalog No.: 166238
    Purity: 95%
    MF: C8H4Cl2N2
    MW: 199.04
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C2C(Cl)=NN=CC2=CC=C1
  2. 1-chloro-4-methylphthalazine

    CAS No.: 19064-68-7
    Catalog No.: 104427
    Purity: 95%
    MF: C9H7ClN2
    MW: 178.622
    Storage: 2-8 degree Celsius
    SMILES: CC1=NN=C(Cl)C2=C1C=CC=C2
  3. 6-(tert-butyl)-8-fluorophthalazin-1(2H)-one

    CAS No.: 1242156-59-7
    Catalog No.: 112262
    Purity: 95%
    MF: C12H13FN2O
    MW: 220.247
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)C1=CC2=C(C(=O)NN=C2)C(F)=C1
  4. 2-(6-(tert-butyl)-8-fluoro-1-oxophthalazin-2(1H)-yl)-6-chlorobenzaldehyde

    CAS No.: 1242156-60-0
    Catalog No.: 131188
    Purity: 95%
    MF: C19H16ClFN2O2
    MW: 358.8
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)C1=CC(F)=C2C(C=NN(C2=O)C2=C(C=O)C(Cl)=CC=C2)=C1
  5. 6-(tert-butyl)-2-(3-chloro-2-(hydroxymethyl)phenyl)-8-fluorophthalazin-1(2H)-one

    CAS No.: 1242156-61-1
    Catalog No.: 131189
    Purity: 95%
    MF: C19H18ClFN2O2
    MW: 360.816
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)C1=CC(F)=C2C(C=NN(C2=O)C2=C(CO)C(Cl)=CC=C2)=C1
  6. 2-(6-(tert-butyl)-8-fluoro-1-oxophthalazin-2(1H)-yl)-6-chlorobenzyl acetate

    CAS No.: 1242157-24-9
    Catalog No.: 131190
    Purity: 95%
    MF: C21H20ClFN2O3
    MW: 402.853
    Storage: 2-8 degree Celsius
    SMILES: CC(=O)OCC1=C(Cl)C=CC=C1N1N=CC2=CC(=CC(F)=C2C1=O)C(C)(C)C
  7. 2-(6-(tert-butyl)-8-fluoro-1-oxophthalazin-2(1H)-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl acetate

    CAS No.: 1242156-76-8
    Catalog No.: 131191
    Purity: 95%
    MF: C27H32BFN2O5
    MW: 494.372
    Storage: 2-8 degree Celsius
    SMILES: C(C)(=O)OCC1=C(C=CC=C1B1OC(C(O1)(C)C)(C)C)N1C(C2=C(C=C(C=C2C=N1)C(C)(C)C)F)=O
  8. N1-(4-methylphthalazin-1-yl)-N2-(pyridin-2-yl)ethane-1,2-diamine

    CAS No.: 1111588-98-7
    Catalog No.: 104877
    Purity: 95%
    MF: C16H17N5
    MW: 279.347
    Storage: 2-8 degree Celsius
    SMILES: CC1=NN=C(NCCNC2=NC=CC=C2)C2=C1C=CC=C2
  9. 6-hydroxy-7-methoxy-2-(methoxymethyl)phthalazin-1(2H)-one

    CAS No.: NA
    Catalog No.: 190876
    Purity: 95%
    MF: C11H12N2O4
    MW: 236.227
    Storage: 2-8 degree Celsius
    SMILES: OC=1C=C2C=NN(C(C2=CC1OC)=O)COC
  10. 1-benzyl-4-chlorophthalazine

    CAS No.: 40848-53-1
    Catalog No.: ZB2279
    Purity: 95%
    MF: C15H11ClN2
    MW: 254.72
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)C1=NN=C(C2=CC=CC=C12)Cl
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 40 total

  1. 1
  2. 2
  3. 3
  4. 4