•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

PARP

Set Ascending Direction

   

Items 31 to 35 of 35 total

  1. 1
  2. 2
  3. 3
  4. 4
  1. GW9662

    CAS No.: 22978-25-2
    Catalog No.: 113774
    Purity: 95%
    MF: C13H9ClN2O3
    MW: 276.679
    Storage: 2-8 degree Celsius
  2. Rucaparib; AG014699; PF-01367338

    CAS No.: 283173-50-2
    Catalog No.: 135206
    Purity: 95%
    MF: C19H18FN3O
    MW: 323.371
    Storage: 2-8 degree Celsius
  3. AZD2461

    CAS No.: 1174043-16-3
    Catalog No.: 136443
    Purity: 95%
    MF: C22H22FN3O3
    MW: 395.434
    Storage: 2-8 degree Celsius
  4. AZ6102

    CAS No.: 1645286-75-4
    Catalog No.: 152081
    Purity: 95%
    MF: C25H28N6O
    MW: 428.54
    Storage: 2-8 degree Celsius
    SMILES: C[C@H]1CN(C[C@@H](C)N1)C1=CC(C)=C(C=N1)C1=CC=C(C=C1)C1=NC2=C(C=CN2C)C(=O)N1
  5. Ciprofibrate

    CAS No.: 52214-84-3
    Catalog No.: 151758
    Purity: 95%
    MF: C13H14Cl2O3
    MW: 289.158
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(OC1=CC=C(C=C1)C1CC1(Cl)Cl)C(O)=O
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 35 of 35 total

  1. 1
  2. 2
  3. 3
  4. 4